- Tillman's Reagent
-
- $2.20 / 100KG
-
2025-10-13
- CAS:620-45-1
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons
|
| | 2,6-Dichloroindophenol sodium salt Basic information |
| Product Name: | 2,6-Dichloroindophenol sodium salt | | Synonyms: | 2.6-Dichloroindophenol sodium salt 1g [620-45-1];2,6-DICHLOROINDOPHENOL, ACS;2,6-Dichlorophenolindophenol sodium salt p.a.;5-cyclohexadien-1-one,2,6-dichloro-4-[(4-hydroxyphenyl)imino]-sodiumsalt;sodium2,6-dichloroindophenol;sodium2,6-dichloroindophenolate;2,6-Dichlorophenolindophenol sodium salt hydrate~Sodium 2,5-dichloroindophenoxide hydrate;sodium 4-(3,5-dichloro-4-oxocyclohexa-2,5-dienylideneamino)phenoxide | | CAS: | 620-45-1 | | MF: | C12H8Cl2NNaO2 | | MW: | 292.09 | | EINECS: | 210-640-4 | | Product Categories: | | | Mol File: | 620-45-1.mol |  |
| | 2,6-Dichloroindophenol sodium salt Chemical Properties |
| Melting point | >300°C | | vapor density | 11.2 (vs air) | | storage temp. | Store at room temperature. | | form | Powder/Solid | | color | Dark green | | Odor | Odorless | | Water Solubility | Soluble in water. | | Sensitive | Light Sensitive | | Merck | 14,3068 | | BRN | 3641229 | | Stability: | Stable. Incompatible with strong oxidizing agents, strong reducing agents. Air and moisture sensitive. Hygroscopic. | | InChI | InChI=1S/C12H7Cl2NO2.Na.H/c13-10-5-8(6-11(14)12(10)17)15-7-1-3-9(16)4-2-7;;/h1-6,16H;; | | InChIKey | BKUKEFKAUWOESM-UHFFFAOYSA-N | | SMILES | N(/C1C=CC(O)=CC=1)=C1/C=C(Cl)C(=O)C(Cl)=C/1.[NaH] | | CAS DataBase Reference | 620-45-1(CAS DataBase Reference) | | EPA Substance Registry System | 2,5-Cyclohexadien-1-one, 2,6-dichloro-4-[(4-hydroxyphenyl)imino]-, sodium salt (620-45-1) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 22-24/25-36-26 | | WGK Germany | 3 | | RTECS | GU5495000 | | F | 8 | | TSCA | Yes | | HS Code | 29252000 |
| | 2,6-Dichloroindophenol sodium salt Usage And Synthesis |
| Chemical Properties | dark green powder | | Uses | A redox indicator dye. | | Application | 2,6-Dichloroindophenol sodium can be used for the determination of ascorbic acid, and redox indicator and chromatographic analysis reagent. | | Definition | ChEBI: 2,6-Dichlorophenolindophenol sodium salt is an organic molecular entity. | | Purification Methods | Dissolve it in 0.001M phosphate buffer, pH 7.5 (alternatively, about 2g of the dye is dissolved in 80mL of M HCl), and extracted into diethyl ether. The extract is washed with water, extracted with aqueous 2% NaHCO3, and the sodium salt of the dye is precipitated by adding NaCl (30g/100mL of NaHCO3 solution), then filtered off, washed with dilute NaCl solution and dried. It has max at 605nm. [Hiromi et al. Anal Biochem 101 421 1980.] The acetate M 310.1 has m 101-103o (from Et2O/pet ether) and 99.5-100.5o (from Et2O). [Beilstein 13 IV 1078-1079.] |
| | 2,6-Dichloroindophenol sodium salt Preparation Products And Raw materials |
|