|
|
| | Bis(2-methoxyethyl) phthalate Basic information |
| Product Name: | Bis(2-methoxyethyl) phthalate | | Synonyms: | PHTHALIC ACID, BIS-METHYLGLYCOL ESTER;PHTHALIC ACID BIS(2-METHOXYETHYL) ESTER;1,2-Benzenedicarboxylic acid, bi(2-methoxyethyl) ester;Phthalic Acid Bis(2-methoxuethyl) Ester;2-methoxyethylphthalate;ai3-01366(usda);Bismethylglycol;Di-(2-methoxyethyl)ester kyseliny ftalove | | CAS: | 117-82-8 | | MF: | C14H18O6 | | MW: | 282.29 | | EINECS: | 204-212-6 | | Product Categories: | Organic synthesis | | Mol File: | 117-82-8.mol |  |
| | Bis(2-methoxyethyl) phthalate Chemical Properties |
| Melting point | -42.4°C | | Boiling point | 230 °C10 mm Hg(lit.) | | density | 1.173 g/mL at 20 °C(lit.) | | refractive index | n20/D 1.503 | | Fp | 230°C/10mm | | storage temp. | Refrigerator | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | form | Liquid | | color | Colorless | | Specific Gravity | 1.17 | | Water Solubility | Soluble in water 8500 mg/L at 25°C. | | BRN | 2056929 | | Henry's Law Constant | 2.3×101 mol/(m3Pa) at 25℃, Fishbein and Albro (1972) | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C14H18O6/c1-17-7-9-19-13(15)11-5-3-4-6-12(11)14(16)20-10-8-18-2/h3-6H,7-10H2,1-2H3 | | InChIKey | HSUIVCLOAAJSRE-UHFFFAOYSA-N | | SMILES | COCCOC(=O)c1ccccc1C(=O)OCCOC | | CAS DataBase Reference | 117-82-8(CAS DataBase Reference) | | NIST Chemistry Reference | Phthalic acid, di(2-methoxyethyl)ester(117-82-8) | | EPA Substance Registry System | Bis(2-methoxyethyl) phthalate (117-82-8) |
| Hazard Codes | T | | Risk Statements | 61-62 | | Safety Statements | 53-45 | | WGK Germany | 3 | | RTECS | TI1400000 | | TSCA | TSCA listed | | HS Code | 29173490 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Repr. 1B | | Hazardous Substances Data | 117-82-8(Hazardous Substances Data) |
| | Bis(2-methoxyethyl) phthalate Usage And Synthesis |
| Chemical Properties | Clear colorless liquid | | Uses | Bis(2-methoxyethyl) Phthalate is a phthalate derivative found in cosmetic products. | | Uses | It finds it application in cosmetic industry. It is also used as a plasticizer for toys, including inflatable water products, hoppers, play and exercise balls. | | Uses | Plasticizer; solvent | | Production Methods | DMEP is formed by the esterification of ethylene glycol
monomethyl ether with phthalic anhydride in the presence of
a catalyst (sulfuric acid or p-toluenesulfonic acid) or noncatalytically
at high temperature. | | Health Hazard | Dimethoxyethyl phthalate
(DMEP) causes teratogenic, reproductive, and
fetotoxic effects in animals. | | Agricultural Uses | Phthalate is the salt or derivative of phthalic acid.
Potassium hydrogen phthalate is the primary standard for
preparing a standard sodium hydroxide solution. Dioctyl
phthalate, an ester of phthalic acid and octyl alcohol is
used as aplasticim inplastics | | Safety Profile | Moderately toxic by
ingestion and intraperitoneal routes. Mddly
toxic by inhalation. Experimental
teratogenic and reproductive effects. A skin
and eye irritant. Mutation data reported. A
pesticide. Combustible when exposed to
heat or flame; can react with oxidizing
materials. To fight fre, use water, foam,
CO2, dry chemical. When heated to
decomposition it emits acrid smoke and
irritating fumes. |
| | Bis(2-methoxyethyl) phthalate Preparation Products And Raw materials |
|