N-Methyl-bis(trifluoroacetamide) manufacturers
|
| | N-Methyl-bis(trifluoroacetamide) Basic information |
| | N-Methyl-bis(trifluoroacetamide) Chemical Properties |
| Boiling point | 121-122 °C(lit.) | | density | 1.547 g/mL at 25 °C | | refractive index | n20/D 1.346(lit.) | | Fp | 42 °C | | storage temp. | 2-8°C | | pka | -3.38±0.70(Predicted) | | form | clear liquid | | color | Colorless to Light yellow | | Specific Gravity | 1.547 | | Sensitive | Moisture Sensitive | | BRN | 1878402 | | InChI | 1S/C5H3F6NO2/c1-12(2(13)4(6,7)8)3(14)5(9,10)11/h1H3 | | InChIKey | AWGBWLXGUPTXHF-UHFFFAOYSA-N | | SMILES | CN(C(=O)C(F)(F)F)C(=O)C(F)(F)F | | CAS DataBase Reference | 685-27-8(CAS DataBase Reference) | | NIST Chemistry Reference | Acetamide, 2,2,2-trifluoro-n-methyl-n-(trifluoroacetyl)-(685-27-8) |
| Hazard Codes | C | | Risk Statements | 10-34-44 | | Safety Statements | 26-36/37/39-45-16 | | RIDADR | UN 2920 8/PG 2 | | WGK Germany | 3 | | F | 10-21 | | Hazard Note | Corrosive/Moisture Sensitive | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29241990 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Flam. Liq. 3 Skin Corr. 1B |
| | N-Methyl-bis(trifluoroacetamide) Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Reagent for introducing trifluoroacetyl group. | | reaction suitability | reagent type: derivatization reagent reaction type: Acylations reagent type: derivatization reagent reaction type: Silylations |
| | N-Methyl-bis(trifluoroacetamide) Preparation Products And Raw materials |
|