|
|
| | Boc-alpha-Cyclohexyl-D-glycine Basic information |
| | Boc-alpha-Cyclohexyl-D-glycine Chemical Properties |
| Melting point | 75°C(lit.) | | Boiling point | 407.9±28.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Store in freezer, under -20°C | | solubility | Chloroform, Dichloromethane, DMSO, Ethyl Acetate | | form | Solid | | pka | 4.01±0.10(Predicted) | | color | Off-White | | Optical Rotation | Consistent with structure | | BRN | 7689661 | | InChI | InChI=1/C13H23NO4/c1-13(2,3)18-12(17)14-10(11(15)16)9-7-5-4-6-8-9/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)/t10-/s3 | | InChIKey | QSUXZIPXYDQFCX-SNVBAGLBSA-N | | SMILES | C1(CCCCC1)[C@H](C(=O)O)NC(=O)OC(C)(C)C |&1:6,r| | | CAS DataBase Reference | 70491-05-3(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29242990 |
| | Boc-alpha-Cyclohexyl-D-glycine Usage And Synthesis |
| Chemical Properties | Off-White Solid | | Uses | Intermediate in the preparation of Ximelagatran. |
| | Boc-alpha-Cyclohexyl-D-glycine Preparation Products And Raw materials |
|