|
|
| | 2-BROMO-4-METHOXYBENZALDEHYDE Basic information |
| Product Name: | 2-BROMO-4-METHOXYBENZALDEHYDE | | Synonyms: | 3-Bromo-4-formylanisole, 2-Bromo-p-anisaldehyde;Benzaldehyde, 2-broMo-4-Methoxy-;2-BroMo-4-Methoxybenzaldehyde, 97+%;3-Bromo-4-formylanisole;B90014;2-Bromo-p-anisaldehyde;4-methoxy-2-bromo benzaldehyde | | CAS: | 43192-31-0 | | MF: | C8H7BrO2 | | MW: | 215.04 | | EINECS: | | | Product Categories: | | | Mol File: | 43192-31-0.mol |  |
| | 2-BROMO-4-METHOXYBENZALDEHYDE Chemical Properties |
| Melting point | 68-69℃ | | Boiling point | 284℃ | | density | 1.522 | | Fp | 126℃ | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | Solid | | InChI | InChI=1S/C8H7BrO2/c1-11-7-3-2-6(5-10)8(9)4-7/h2-5H,1H3 | | InChIKey | ODISAUHBLBVQKC-UHFFFAOYSA-N | | SMILES | C(=O)C1=CC=C(OC)C=C1Br | | CAS DataBase Reference | 43192-31-0 |
| Hazard Codes | Xn,N | | Risk Statements | 22-50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | HS Code | 2912490090 |
| | 2-BROMO-4-METHOXYBENZALDEHYDE Usage And Synthesis |
| Chemical Properties | White solid | | Uses | 2-Bromo-4-methoxybenzaldehyde is an organic compound that is often used as an intermediate in organic synthesis, especially in pharmaceutical and pesticide chemistry. |
| | 2-BROMO-4-METHOXYBENZALDEHYDE Preparation Products And Raw materials |
|