1-(2,6-DIMETHYLPHENOXY)ACETONE manufacturers
|
| 1-(2,6-DIMETHYLPHENOXY)ACETONE Basic information |
| 1-(2,6-DIMETHYLPHENOXY)ACETONE Chemical Properties |
Boiling point | 113°C/4mmHg(lit.) | density | 1.011±0.06 g/cm3(Predicted) | refractive index | 1.5060 to 1.5100 | storage temp. | Refrigerator | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | form | Oil | color | Colourless to Orange | InChI | InChI=1S/C11H14O2/c1-8-5-4-6-9(2)11(8)13-7-10(3)12/h4-6H,7H2,1-3H3 | InChIKey | XDJULAUHYAJQBU-UHFFFAOYSA-N | SMILES | C(OC1=C(C)C=CC=C1C)C(=O)C | LogP | 2.3 at 20℃ | CAS DataBase Reference | 53012-41-2 |
| 1-(2,6-DIMETHYLPHENOXY)ACETONE Usage And Synthesis |
Chemical Properties | Yellow Oil | Uses | Mexiletine (M340800) metabolite. |
| 1-(2,6-DIMETHYLPHENOXY)ACETONE Preparation Products And Raw materials |
|