|
|
| | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate Basic information |
| Product Name: | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate | | Synonyms: | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate;4-(4-Hydroxybutyl)piperidine-1-carboxylic acid tert-butyl ester;1-Piperidinecarboxylic acid, 4-(4-hydroxybutyl)-, 1,1-diMethylethyl ester;4-(1-Boc-4-piperidyl)-1-butanol;tert-Butyl 4-(4-hydroxybutyl);4-(1-tert-butoxycarbonylpiperidin-4-yl)-butan-1-ol;Tirofiban Impurity 53;N-Boc-4-(4-hydroxybutyl)piperidine | | CAS: | 142355-83-7 | | MF: | C14H27NO3 | | MW: | 257.37 | | EINECS: | | | Product Categories: | | | Mol File: | 142355-83-7.mol |  |
| | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate Chemical Properties |
| Boiling point | 355.1±15.0 °C(Predicted) | | density | 1.018 | | storage temp. | 2-8°C | | pka | 15.18±0.10(Predicted) | | Appearance | Colorless to light yellow Viscous liquid | | InChI | InChI=1S/C14H27NO3/c1-14(2,3)18-13(17)15-9-7-12(8-10-15)6-4-5-11-16/h12,16H,4-11H2,1-3H3 | | InChIKey | GVOGVPFQDCQZNP-UHFFFAOYSA-N | | SMILES | N1(C(OC(C)(C)C)=O)CCC(CCCCO)CC1 |
| | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate Usage And Synthesis |
| | tert-butyl 4-(4-hydroxybutyl)piperidine-1-carboxylate Preparation Products And Raw materials |
|