|
|
| | (S)-N-Fmoc-2-(2'-propylenyl)alanine Basic information |
| Product Name: | (S)-N-Fmoc-2-(2'-propylenyl)alanine | | Synonyms: | (S)-N-Fmoc-2-(2'-propylenyl)alanine;(2S)-2-[[(9H-Fluoren-9-ylmethoxy)carbonyl]amino]-2-methyl-4-pentenoic acid;(S)-N-Fmoc-alpha-allylalanine;(S)-N-(9-Fluorenylmethylcarbamate)-2-(2'-propylenyl)alanine;Fmoc-alpha-methyl-L-allylglycine;(S)-N-FMOC-Α-ALLYLALANINE;(S)-N-Fmoc-α-2-n-propenylalanine;Fmoc-(S)-2-(2-propenyl)alanine | | CAS: | 288617-71-0 | | MF: | C21H21NO4 | | MW: | 351.4 | | EINECS: | | | Product Categories: | α-Methyl Amino Acids | | Mol File: | 288617-71-0.mol |  |
| | (S)-N-Fmoc-2-(2'-propylenyl)alanine Chemical Properties |
| Boiling point | 564.3±45.0 °C(Predicted) | | density | 1.224 | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | 3.81±0.11(Predicted) | | form | liquid | | color | pale yellow | | Major Application | peptide synthesis | | InChI | InChI=1S/C21H21NO4/c1-3-12-21(2,19(23)24)22-20(25)26-13-18-16-10-6-4-8-14(16)15-9-5-7-11-17(15)18/h3-11,18H,1,12-13H2,2H3,(H,22,25)(H,23,24)/t21-/m0/s1 | | InChIKey | FNCSRFHDUZYOCR-NRFANRHFSA-N | | SMILES | C(O)(=O)[C@](NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O)(C)CC=C |
| Hazard Codes | N | | Risk Statements | 50 | | Safety Statements | 61 | | RIDADR | UN 3077 9 / PGIII | | WGK Germany | 3 | | TSCA | No | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Acute 1 |
| | (S)-N-Fmoc-2-(2'-propylenyl)alanine Usage And Synthesis |
| Uses | Olefinic alpha-methyl amino acid for peptide stapling. Upon incorporation of this amino acid into a peptide, along with another of the same or derivative with a different length of the olefinic side chain, the two can be ′stapled′ via a ring closing metathesis reaction with Grubb′s catalyst (product # 579726). The resulting stapled peptide macrocycle has been shown to stabilize the alpha-helical structure of peptides, which can lead to favorable biological characteristics such as increased proteolytic stability and cellular uptake. | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | (S)-N-Fmoc-2-(2'-propylenyl)alanine Preparation Products And Raw materials |
|