| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
|
| | Fmoc-Alg(Boc)2-OH Basic information |
| Product Name: | Fmoc-Alg(Boc)2-OH | | Synonyms: | Fmoc-Alg(Boc)2-OH;FMoc-Agp(Boc)2-OH;(3S)-3-Carboxy-6-[[(1,1-dimethylethoxy)carbonyl]amino]-10,10-dimethyl-8-oxo-9-oxa-2,5,7-triazaundec-5-enoic acid 1-(9H-fluoren-9-ylmethyl) ester;Fmoc-L-Alg(Boc)2-OH;(2S)-3-{[bis({[(tert-butoxy)carbonyl]amino})methylidene]amino}-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)propanoic acid;(2S)-3-[bis[(2-methylpropan-2-yl)oxycarbonylamino]methylideneamino]-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid;FMOC-AGP(BOC)2-OH 1 G;9-Oxa-2,5,7-triazaundec-5-enoic acid, 3-carboxy-6-[[(1,1-dimethylethoxy)carbonyl]amino]-10,10-dimethyl-8-oxo-, 1-(9H-fluoren-9-ylmethyl) ester, (3S)- | | CAS: | 313232-63-2 | | MF: | C29H36N4O8 | | MW: | 568.62 | | EINECS: | | | Product Categories: | amino acids | | Mol File: | 313232-63-2.mol |  |
| | Fmoc-Alg(Boc)2-OH Chemical Properties |
| density | 1.28±0.1 g/cm3(Predicted) | | storage temp. | Store at -15°C to -25°C. | | form | powder | | pka | 3.31±0.10(Predicted) | | Major Application | peptide synthesis | | InChIKey | KWUNKMXCVKSAEL-QFIPXVFZSA-N | | SMILES | N([C@@H](CN=C(NC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C)C(=O)O)C(=O)OCC1c2c(cccc2)c3c1cccc3 |
| WGK Germany | WGK 2 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-Alg(Boc)2-OH Usage And Synthesis |
| Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-Alg(Boc)2-OH Preparation Products And Raw materials |
|