| Company Name: |
Sigma-Aldrich |
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Company Name: |
SPIRO PHARMA |
| Tel: |
|
| Email: |
eric_feng1954@126.com |
|
| | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol Basic information |
| Product Name: | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol | | Synonyms: | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol;3-Oxetanol, 3-[4-(tributylstannyl)-2-thiazolyl]-;3-(4-tributylstannyl-1,3-thiazol-2-yl)oxetan-3-ol;3-[4-(Tributylstannyl)-2-thiazolyl]-3-oxetanol;3-[4-(Tributylstannyl)-2-thiazolyl]oxetan-3-ol;3-[4-(Tributyl-stannyl)-thiazol-2-yl]-3-oxetanol | | CAS: | 1245816-13-0 | | MF: | C18H33NO2SSn | | MW: | 446.24 | | EINECS: | | | Product Categories: | Stannanes | | Mol File: | 1245816-13-0.mol |  |
| | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol Chemical Properties |
| form | solid | | InChI | 1S/C6H6NO2S.3C4H9.Sn/c8-6(3-9-4-6)5-7-1-2-10-5;3*1-3-4-2;/h2,8H,3-4H2;3*1,3-4H2,2H3; | | InChIKey | UBCXEYOVGVNHSH-UHFFFAOYSA-N | | SMILES | CCCC[Sn](CCCC)(CCCC)C1=CSC(C2(COC2)O)=N1 |
| WGK Germany | WGK 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3
toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral
Acute Tox. 4 Dermal
Aquatic Acute 1
Aquatic Chronic 1
Eye Irrit. 2
Repr. 1B
Skin Irrit. 2
STOT RE 1 |
| | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol Usage And Synthesis |
| | 3-(4-(Tributylstannyl)thiazol-2-yl)oxetan-3-ol Preparation Products And Raw materials |
|