|
|
| | Defluoro Levofloxacin Basic information |
| | Defluoro Levofloxacin Chemical Properties |
| Melting point | 217-223?C | | Boiling point | 561.4±50.0 °C(Predicted) | | density | 1.43±0.1 g/cm3(Predicted) | | storage temp. | Refrigerator, Under Inert Atmosphere | | solubility | DMSO (Slightly), Methanol (Slightly, Sonicated, Heated) | | form | Solid | | pka | 5?+-.0.40(Predicted) | | color | White to Dark Yellow | | InChI | InChI=1S/C18H21N3O4/c1-11-10-25-17-14(20-7-5-19(2)6-8-20)4-3-12-15(17)21(11)9-13(16(12)22)18(23)24/h3-4,9,11H,5-8,10H2,1-2H3,(H,23,24)/t11-/m0/s1 | | InChIKey | ANLIAKDHRADSBT-NSHDSACASA-N | | SMILES | O1C2=C(N3CCN(C)CC3)C=CC3C(=O)C(C(O)=O)=CN(C2=3)[C@@H](C)C1 | | CAS DataBase Reference | 117620-85-6 |
| | Defluoro Levofloxacin Usage And Synthesis |
| Chemical Properties | Off-White to Yellow Solid | | Uses | Nonfluorinated analog of Levofloxacin (L360000). Levofloxacin USP Related Compound F. |
| | Defluoro Levofloxacin Preparation Products And Raw materials |
|