|
|
| | ATTO 680 NHS ester Basic information |
| | ATTO 680 NHS ester Chemical Properties |
| storage temp. | -20°C | | form | powder | | InChIKey | PVQYIKUDSQLKDA-UHFFFAOYSA-N | | SMILES | [S](=O)(=O)([O-])CC1=CC(N(c3c1cc4nc5c([o+]c4c3)cc6c(c5)CCCN6CC)CCCC(=O)ON2C(=O)CCC2=O)(C)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | ATTO 680 NHS ester Usage And Synthesis |
| Uses | Molar absorption 120,000 1/M cm, abs: 675 nm, em: 705 nm, QY=0.3, Tfl 1.7 ns (unpublished data); excitation energy acceptor in an acceptor/donor zeolite system. |
| | ATTO 680 NHS ester Preparation Products And Raw materials |
|