| Company Name: |
ChemPep, Inc. |
| Tel: |
+1 (888) 615-9178 / (561) 791-8787 |
| Email: |
service@chempep.com |
|
| | Fmoc-N-methyl-L-methionine Basic information |
| Product Name: | Fmoc-N-methyl-L-methionine | | Synonyms: | Fmoc-N-methyl-L-methionine;FMoc-N-Me-L-Met-OH;L-Methionine, N-[(9H-fluoren-9-ylMethoxy)carbonyl]-N-Methyl-;N-Methyl methionine;(2S)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl](methyl)amino}-4-(methylsulfanyl)butanoic acid;N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-N-methyl-L-methionine;(9H-Fluoren-9-yl)MethOxy]Carbonyl N-Me-Met-OH;FMOC-N-ME-MET-OH 1 G | | CAS: | 84000-12-4 | | MF: | C21H23NO4S | | MW: | 385.48 | | EINECS: | | | Product Categories: | amino acids | | Mol File: | 84000-12-4.mol |  |
| | Fmoc-N-methyl-L-methionine Chemical Properties |
| Melting point | 150-155°C | | Boiling point | 587.6±50.0 °C(Predicted) | | density | 1.265±0.06 g/cm3(Predicted) | | storage temp. | Store below +30°C. | | form | powder or crystals | | pka | 3.73±0.10(Predicted) | | color | white to beige | | Optical Rotation | Consistent with structure | | Major Application | peptide synthesis | | InChI | 1S/C21H23NO4S/c1-22(19(20(23)24)11-12-27-2)21(25)26-13-18-16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h3-10,18-19H,11-13H2,1-2H3,(H,23,24)/t19-/m0/s1 | | InChIKey | SPYUJXKMEJUAOI-IBGZPJMESA-N | | SMILES | CSCC[C@H](N(C)C(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O |
| WGK Germany | 3 | | HS Code | 2930 90 98 | | Storage Class | 11 - Combustible Solids |
| | Fmoc-N-methyl-L-methionine Usage And Synthesis |
| Chemical Properties | White powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | Fmoc-N-methyl-L-methionine Preparation Products And Raw materials |
|