|
|
| | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride Basic information |
| Product Name: | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride | | Synonyms: | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride;1-(Cyclopropylcarbonyl)piperazine hydrochloride, [(Piperazin-1-yl)carbonyl]cyclopropane hydrochloride;Cyclopropyl(piperazin-1-yl)methanone hydrochloride 97%;OlaparibIntermediate;1- cyclopropylmethyl-formyl piperazine hydrochloride;1-(CYCLOPROPANECARBONYL)PIPERAZINE HCl;1-(cyclopropanecarbonyl)piperazine hydrochloride;N-(Cyclopropylcarbonyl)piperazine hydrochloride | | CAS: | 1021298-67-8 | | MF: | C8H15ClN2O | | MW: | 190.67 | | EINECS: | 810-996-6 | | Product Categories: | | | Mol File: | 1021298-67-8.mol |  |
| | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride Chemical Properties |
| Melting point | 175-179℃ | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble[in water] | | Water Solubility | Soluble in water | | form | powder to crystal | | color | White to Orange to Green | | InChI | InChI=1S/C8H14N2O.ClH/c11-8(7-1-2-7)10-5-3-9-4-6-10;/h7,9H,1-6H2;1H | | InChIKey | WIHDAPMHNYYTOA-UHFFFAOYSA-N | | SMILES | C(N1CCNCC1)(C1CC1)=O.Cl | | CAS DataBase Reference | 1021298-67-8 |
| | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride Usage And Synthesis |
| Uses | 1-(Cyclopropylcarbonyl)piperazine Hydrochloride is a reagent used in the synthesis of Esaprazole analogs showing σ1 binding and neuroprotective properties in vitro. | | Synthesis | The general procedure for the synthesis of cyclopropyl (piperazin-1-yl)methanone hydrochloride from tert-butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate was as follows: to a stirring solution of tert-butyl 4-(cyclopropanecarbonyl)piperazine-1-carboxylate (3.7 g, 14.5 mmol) in methanol (15 mL) was added slowly at 0 °C a hydrochloric acid/methanol solution (15 mL, 3M). After addition, the reaction mixture was stirred at room temperature overnight. Upon completion of the reaction, the solvent was removed by concentration under reduced pressure to afford cyclopropyl (piperazin-1-yl)methanone hydrochloride (2.74 g, 100% yield) as an off-white solid. The product was characterized by 1H-NMR (400 MHz, DMSO-d6): δ 0.71-0.76 (m, 4H), 1.96-2.03 (m, 1H), 3.04-3.16 (m, 4H), 3.69-4.08 (m, 4H), 9.58 (s, 2H); LC-MS (ESI) m/z: 155 (M + 1)+. | | References | [1] Patent: US2010/35883, 2010, A1. Location in patent: Page/Page column 56
[2] Patent: WO2011/130661, 2011, A1. Location in patent: Page/Page column 102-103 |
| | Piperazine, 1-(cyclopropylcarbonyl)-, Monohydrochloride Preparation Products And Raw materials |
|