Azilsartan iMpurity manufacturers
- Azilsartan impurity Q
-
- $0.00 / 10mg
-
2025-09-25
- CAS:1604812-35-2
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
- Azilsartan impurity Q
-
- $0.00 / 10mg
-
2025-07-31
- CAS:1604812-35-2
- Min. Order: 10mg
- Purity: 95%+
- Supply Ability: 1000000000000
|
| | Azilsartan iMpurity Basic information |
| Product Name: | Azilsartan iMpurity | | Synonyms: | Azilsartan iMpurity;(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-1-((2'-(4-((5-methyl-2-oxo-1,3-dioxol-4-yl)methyl)-5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)-[1,1'-biphenyl]-4-yl)methyl)-1H-benzo[d]imidazole-7-carboxylate;Azilsartan Impurity 33;Azilsartan impurity 19/(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl 2-ethoxy-1-((2'-(4-((5-methyl-2-oxo-1,3-dioxol-4-yl)methyl)-5-oxo-4,5-dihydro-1,2,4-oxadiazol-3-yl)-[1,1'-biphenyl]-4-yl)methyl)-1H-benzo[d]imidazole-7-carboxylate;(5-methyl-2-oxo-1,3-dioxol-4-yl);Azilsartan-18;1H-Benzimidazole-7-carboxylic acid, 1-[[2'-[4,5-dihydro-4-[(5-methyl-2-oxo-1,3-dioxol-4-yl)methyl]-5-oxo-1,2,4-oxadiazol-3-yl][1,1'-biphenyl]-4-yl]methyl]-2-ethoxy-, (5-methyl-2-oxo-1,3-dioxol-4-yl)methyl ester;Azilsartan Dimer | | CAS: | 1604812-35-2 | | MF: | C35H28N4O11 | | MW: | 680.62 | | EINECS: | | | Product Categories: | | | Mol File: | 1604812-35-2.mol |  |
| | Azilsartan iMpurity Chemical Properties |
| Boiling point | 813.4±75.0 °C(Predicted) | | density | 1.48±0.1 g/cm3(Predicted) | | storage temp. | 4°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.07±0.10(Predicted) | | color | Off-White to Pale Yellow | | InChIKey | PIGXPFQGERNXGJ-UHFFFAOYSA-N | | SMILES | C1(OCC)N(CC2=CC=C(C3=CC=CC=C3C3N(CC4=C(C)OC(=O)O4)C(=O)ON=3)C=C2)C2=C(C(OCC3=C(C)OC(=O)O3)=O)C=CC=C2N=1 |
| | Azilsartan iMpurity Usage And Synthesis |
| Uses | Azilsartan Dimer is an impurity of Azilsartan (A926900). Azilsartan is an analgesic and antiinflammatory drugs containing angiotensin II antagonists. |
| | Azilsartan iMpurity Preparation Products And Raw materials |
|