| Company Name: |
Hubei Yangxin Medical Technology Co., Ltd. Gold
|
| Tel: |
15374522761 |
| Email: |
3003392093@yongstandards.com |
| Products Intro: |
Product Name:Pyridoxine Impurity 45 Dihydrochloride
CAS:19203-56-6
Purity:99%+ HPLC Package:10mg;25mg;50mg;100mg
|
Bispyridoxine manufacturers
- Vitamin B6 Impurity 22
-
- $0.00 / 10mg
-
2026-01-19
- CAS:19203-56-6
- Min. Order: 10mg
- Purity: 98%
- Supply Ability: 500mg
|
| | Bispyridoxine Basic information |
| Product Name: | Bispyridoxine | | Synonyms: | 5,4',5'-tris-hydroxymethyl-2,2'-dimethyl-4,6'-methanediyl-bis-pyridin-3-ol;3,4-Pyridinedimethanol, 5-hydroxy-2-[[3-hydroxy-5-(hydroxymethyl)-2-methyl-4-pyridinyl]methyl]-6-methyl-;Pyridoxine Dimer;(5-hydroxy-2-((3-hydroxy-5-(hydroxymethyl)-2-methylpyridin-4-yl)methyl)-6-methylpyridine-3,4-diyl)dimethanol;Pyridoxine Impurity 45;Vitamin B6 Impurity 22;Vitamin B6 impurity F;Bispyridoxine | | CAS: | 19203-56-6 | | MF: | C16H20N2O5 | | MW: | 320.34 | | EINECS: | | | Product Categories: | | | Mol File: | 19203-56-6.mol |  |
| | Bispyridoxine Chemical Properties |
| Boiling point | 744.7±55.0 °C(Predicted) | | density | 1.416±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 9.52±0.10(Predicted) | | color | Off-White to Dark Grey | | Stability: | Hygroscopic, Temperature Sensitive | | Major Application | pharmaceutical small molecule | | InChI | InChI=1S/C16H20N2O5/c1-8-15(22)11(10(5-19)4-17-8)3-14-12(6-20)13(7-21)16(23)9(2)18-14/h4,19-23H,3,5-7H2,1-2H3 | | InChIKey | RAZATUNSMMRNNT-UHFFFAOYSA-N | | SMILES | C1(CC2C(CO)=CN=C(C)C=2O)=NC(C)=C(O)C(CO)=C1CO |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | Bispyridoxine Usage And Synthesis |
| Uses | Pyridoxine Dimer is used as analyte in synthetic preparation and analysis of photo- and heat-reaction products of vitamin B6. |
| | Bispyridoxine Preparation Products And Raw materials |
|