|
|
| | Azido-Bib Basic information |
| Product Name: | Azido-Bib | | Synonyms: | 2′-Azidoethyl 2-bromoisobutyrate;2-Azidoethyl 2-bromo-2-methylpropanoate;2-Azidoethyl 2-bromoisobutyrate;2-Azidoethyl-2-bromoisobutyrate;2-Bromo-2-methyl-propanoic acid 2-azidoethyl ester;Azido-ATRP initiator;Azido-Bib;2-Azidoethyl 2-bromoisobutyrate 97% | | CAS: | 1120364-53-5 | | MF: | C6H10BrN3O2 | | MW: | 236.07 | | EINECS: | | | Product Categories: | | | Mol File: | 1120364-53-5.mol |  |
| | Azido-Bib Chemical Properties |
| density | 1.437 g/mL at 25 °C | | refractive index | n20/D1.482 | | Fp | >110℃ | | form | solid | | InChI | InChI=1S/C6H10BrN3O2/c1-6(2,7)5(11)12-4-3-9-10-8/h3-4H2,1-2H3 | | InChIKey | OYSXPOJKJKBNSG-UHFFFAOYSA-N | | SMILES | C(=O)(C(C)(C)Br)OCCN=[N+]=[N-] |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 |
| | Azido-Bib Usage And Synthesis |
| Uses | Bifunctional initiator with a bromoisobutyryl moiety for atom transfer radical polymerization (ATRP) and an azide moiety that can be used in Cu-mediated ligation ("click" chemistry) for biomaterials, carbon nanotubes and graphene sheets. | | IC 50 | Alkyl/ether |
| | Azido-Bib Preparation Products And Raw materials |
|