|
|
| | 3-Acetyl-2,5-dichlorothiophene Basic information |
| | 3-Acetyl-2,5-dichlorothiophene Chemical Properties |
| Melting point | 37-40 °C (lit.) | | Boiling point | 120-122°C 4mm | | density | 1.4514 (estimate) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | solid | | color | White to Yellow to Orange | | BRN | 121288 | | InChI | InChI=1S/C6H4Cl2OS/c1-3(9)4-2-5(7)10-6(4)8/h2H,1H3 | | InChIKey | GYFDNIRENHZKGR-UHFFFAOYSA-N | | SMILES | C(=O)(C1C=C(Cl)SC=1Cl)C | | CAS DataBase Reference | 36157-40-1(CAS DataBase Reference) | | NIST Chemistry Reference | 2,5-Dichloro-3-thienyl methyl ketone(36157-40-1) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-36-36/37/39-22-36/37 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29349990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Inhalation
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | 3-Acetyl-2,5-dichlorothiophene Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powder | | Uses | 3-Acetyl-2,5-dichlorothiophene may be used in the following syntheses:
- substituted chalcones
- AL-4623A and AL-4862 (brinzolamide), inhibitors of topical carbonic anhydrase
- 2,5-dichlorothiophene-3-carboxylic acid, which is the starting reagent required for the synthesis of 2,5-dichloro-N-(substituted amino-carbonothioyl)thiophene-3-carboxamides and 2-(substituted amino)-4H-thieno[3,2-e]-1,3-thiazin-4-ones
| | Definition | ChEBI: 1-(2,5-Dichloro-3-thienyl)ethan-1-one is an aromatic ketone. | | Synthesis | 1-Methyl-4-chlorobutenal was reacted with a strong base to remove the active hydrogen at the ??-position, then docked with thioacetyl chloride and reacted at 60-80 degrees Celsius to obtain the target product 3-acetyl-2,5-dichlorothiophene. |
| | 3-Acetyl-2,5-dichlorothiophene Preparation Products And Raw materials |
|