|
| 2-Fluoro-6-formylpyridine Basic information |
Product Name: | 2-Fluoro-6-formylpyridine | Synonyms: | 2-FLUORO-6-FORMYLPYRIDINE;CHEMPACIFIC 38134;6-Fluoropyridine-2-carboxalehyde;6-FLUORO-PYRIDINE-2-CARBALDEHYDE;6-Fluoropyridine-2-carboxaldehyde;2-Pyridinecarboxaldehyde,6-fluoro-(9CI);6-Fluoropicolinaldehyde;6-FLUOROPICOLINALDEHYDE,98.5% | CAS: | 208110-81-0 | MF: | C6H4FNO | MW: | 125.1 | EINECS: | | Product Categories: | PYRIDINE | Mol File: | 208110-81-0.mol |  |
| 2-Fluoro-6-formylpyridine Chemical Properties |
Boiling point | 192.4±20.0 °C(Predicted) | density | 1.269±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | pka | 0.80±0.10(Predicted) | form | liquid | color | Clear, dark yellow | InChI | InChI=1S/C6H4FNO/c7-6-3-1-2-5(4-9)8-6/h1-4H | InChIKey | HENWRHPVXMPQNF-UHFFFAOYSA-N | SMILES | C1(C=O)=NC(F)=CC=C1 | CAS DataBase Reference | 208110-81-0(CAS DataBase Reference) |
| 2-Fluoro-6-formylpyridine Usage And Synthesis |
Uses | 2-Fluoro-6-formylpyridine is used in the synthesis of fluoroheterocyclic aldoximes which are therapeutic agents for the treatment of anti-cholinesterase poisoning. |
| 2-Fluoro-6-formylpyridine Preparation Products And Raw materials |
|