|
|
| | SGD 1882 Basic information |
| Product Name: | SGD 1882 | | Synonyms: | SGD 1882;5H-Pyrrolo[2,1-c][1,4]benzodiazepin-5-one, 2-(4-aminophenyl)-8-[3-[[(11aS)-5,11a-dihydro-7-methoxy-2-(4-methoxyphenyl)-5-oxo-1H-pyrrolo[2,1-c][1,4]benzodiazepin-8-yl]oxy]propoxy]-1,11a-dihydro-7-methoxy-, (11aS)-;PBD dimer;SGD1882,SGD 1882 | | CAS: | 1222490-34-7 | | MF: | C42H39N5O7 | | MW: | 725.79 | | EINECS: | | | Product Categories: | | | Mol File: | 1222490-34-7.mol |  |
| | SGD 1882 Chemical Properties |
| Boiling point | 977.7±65.0 °C(Predicted) | | density | 1.36±0.1 g/cm3(Predicted) | | pka | 5.07±0.10(Predicted) | | InChIKey | OMRPLUKQNWNZAV-CONSDPRKSA-N | | SMILES | N1C2=CC(OCCCOC3C=C4N=C[C@]5([H])CC(C6=CC=C(OC)C=C6)=CN5C(=O)C4=CC=3OC)=C(OC)C=C2C(=O)N2C=C(C3=CC=C(N)C=C3)C[C@@]2([H])C=1 |
| | SGD 1882 Usage And Synthesis |
| | SGD 1882 Preparation Products And Raw materials |
|