|
|
| Product Name: | NPTPT | | Synonyms: | N-(N-Propyl)thiophosphoric triamide;NPTPT;Phosphorothioic triamide, N-propyl-;NPTPT ISO 9001：2015 REACH;[[]diamino(sulfanylidene)-lambda5-phosphanyl](propyl)amine;NPPT;N-Propylphosphorothioic Triamide | | CAS: | 916809-14-8 | | MF: | C3H12N3PS | | MW: | 153.19 | | EINECS: | 618-780-1 | | Product Categories: | | | Mol File: | 916809-14-8.mol |  |
| | NPTPT Chemical Properties |
| Melting point | 89 - 92°C | | Boiling point | 262.1±23.0 °C(Predicted) | | density | 1.253 at 20℃ | | vapor pressure | 0-0.016Pa at 20-50℃ | | storage temp. | Refrigerator, Under inert atmosphere | | solubility | Chloroform (Slightly, Heated), Methanol (Slightly, Heated) | | form | Solid | | pka | 6.27±0.70(Predicted) | | color | White to Off-White | | LogP | 0.3 at 24℃ |
| | NPTPT Usage And Synthesis |
| Uses | N-Propylphosphorothioic triamide is used to significantly reduce ammonia volatilization in urea. |
| | NPTPT Preparation Products And Raw materials |
|