|
|
| | 2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 Basic information |
| Product Name: | 2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 | | Synonyms: | 2,4,4'-Trichlorobiphenyl-d4 Solution, 100μg/mL;2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 ;PCB 28-[D4](2，4，4‘-Trichlorobiphenyl-2‘，3‘，5‘，6‘-D4);2,4,4'-Trichlorobiphenyl-d4;2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4;2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 in isooctane;2,4,4′-Trichlorobiphenyl-2′,3′,5′,6′-d4 (BZ# 28) & 2,3,4,4’,5-pentachlorobiphenyl-d4 Solution 10 mg/L;2,4,4'-Trichloro-1,1'-biphenyl-D4 | | CAS: | 1219799-32-2 | | MF: | C12H7Cl3 | | MW: | 257.54 | | EINECS: | | | Product Categories: | | | Mol File: | 1219799-32-2.mol |  |
| | 2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 Chemical Properties |
| Melting point | 55 - 57°C | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly). Methanol (Very Slightly) | | form | Solid | | color | White to Off-White | | InChI | InChI=1S/C12H7Cl3/c13-9-3-1-8(2-4-9)11-6-5-10(14)7-12(11)15/h1-7H | | InChIKey | BZTYNSQSZHARAZ-UHFFFAOYSA-N | | SMILES | ClC1C=C(Cl)C=CC=1C1C([H])=C([H])C(Cl)=C([H])C=1[H] |
| | 2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 Usage And Synthesis |
| Uses | 2,4,4''-Trichlorobiphenyl-2'',3'',5'',6''-d4 (CAS# 1219799-32-2) is the labelled version of 2,4,4''-Trichlorobiphenyl (T774035(M)), which is a polychlorinated biphenyl (PCB) found in air, soil, mammals, and marine animals. |
| | 2,4,4'-Trichlorobiphenyl-2',3',5',6'-d4 Preparation Products And Raw materials |
|