|
|
| | 2-(4-Diethylamino-2-hydroxybenzoyl)benzoic acid Basic information |
| | 2-(4-Diethylamino-2-hydroxybenzoyl)benzoic acid Chemical Properties |
| Melting point | 180°C(dec.)(lit.) | | Boiling point | 537.1±45.0 °C(Predicted) | | density | 1?+-.0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Dimethylformamide | | form | powder to crystal | | pka | 3.27±0.36(Predicted) | | color | White to Light yellow to Light red | | InChI | InChI=1S/C18H19NO4/c1-3-19(4-2)12-9-10-15(16(20)11-12)17(21)13-7-5-6-8-14(13)18(22)23/h5-11,20H,3-4H2,1-2H3,(H,22,23) | | InChIKey | FQNKTJPBXAZUGC-UHFFFAOYSA-N | | SMILES | C(O)(=O)C1=CC=CC=C1C(=O)C1=CC=C(N(CC)CC)C=C1O | | CAS DataBase Reference | 5809-23-4(CAS DataBase Reference) | | EPA Substance Registry System | Benzoic acid, 2-[4-(diethylamino)-2-hydroxybenzoyl]- (5809-23-4) |
| | 2-(4-Diethylamino-2-hydroxybenzoyl)benzoic acid Usage And Synthesis |
| Uses |
2-(4-diethylamino-2-hydroxybenzoyl)benzoic acid could synthesize a novel fluorescent matrix, a hybrid (CzR) of carbazole, i.e. 2-hydroxycarbazole and rhodamine according to acid-promoted Friedel-Crafts acylation procedure with 2-hydroxycarbazole[1].
| | References |
[1] Xiaojie Jiao . “A highly selective and pH-tolerance fluorescent probe for Cu2+ based on a novel carbazole-rhodamine hybrid dye.” Dyes and Pigments 160 (2019): Pages 633-640.
|
| | 2-(4-Diethylamino-2-hydroxybenzoyl)benzoic acid Preparation Products And Raw materials |
|