- 1-Pyrenecarboxaldehyde
-
- $188.00 / 1KG
-
2024-01-06
- CAS:3029-19-4
- Min. Order: 1KG
- Purity: 99%, 99.5% Sublimated
- Supply Ability: g-kg-tons, free sample is available
- 1-Pyrenecarboxaldehyde
-
- $0.00 / 1kg
-
2023-11-18
- CAS:3029-19-4
- Min. Order: 1kg
- Purity: 99.9%
- Supply Ability: 30000 Kg
|
| | 1-Pyrenecarboxaldehyde Basic information |
| | 1-Pyrenecarboxaldehyde Chemical Properties |
| Melting point | 123-126 °C (lit.) | | Boiling point | 312.25°C (rough estimate) | | density | 1.1350 (rough estimate) | | refractive index | 1.4500 (estimate) | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Solid | | color | yellow | | Water Solubility | Insoluble in water. | | Sensitive | Air Sensitive | | BRN | 1874889 | | InChI | InChI=1S/C17H10O/c18-10-14-7-6-13-5-4-11-2-1-3-12-8-9-15(14)17(13)16(11)12/h1-10H | | InChIKey | RCYFOPUXRMOLQM-UHFFFAOYSA-N | | SMILES | C1(C=O)=C2C3=C4C(C=C2)=CC=CC4=CC=C3C=C1 | | CAS DataBase Reference | 3029-19-4(CAS DataBase Reference) | | NIST Chemistry Reference | 1-Pyrene-carboxaldehyde(3029-19-4) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | RTECS | UR2450200 | | F | 10 | | HS Code | 29122990 |
| | 1-Pyrenecarboxaldehyde Usage And Synthesis |
| Chemical Properties | Dark Yellow Solid | | Uses | A novel base-discriminating fluorescent (BDF) compound: a highly polarity-sensitive fluorophore for SNP typing. | | Uses | 1-Pyrenecarboxaldehyde is a important intermediate used in agrochemical, pharmaceutical and dyestuff field. It is used as a highly polarity-sensitive fluorophore for SNP typing. | | Purification Methods | Recrystallise the aldehyde three times from aqueous EtOH. [Beilstein 7 IV 1821.] |
| | 1-Pyrenecarboxaldehyde Preparation Products And Raw materials |
|