|
| 4-BROMO-3-HYDROXYBENZOIC ACID Basic information |
| 4-BROMO-3-HYDROXYBENZOIC ACID Chemical Properties |
Melting point | 225-227 | Boiling point | 338.6±32.0 °C(Predicted) | density | 1.861±0.06 g/cm3(Predicted) | storage temp. | Inert atmosphere,Room Temperature | solubility | Soluble in DMSO | form | solid | pka | 3.85±0.10(Predicted) | color | White | InChI | InChI=1S/C7H5BrO3/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,9H,(H,10,11) | InChIKey | PAJSESFUWIYFNF-UHFFFAOYSA-N | SMILES | C(O)(=O)C1=CC=C(Br)C(O)=C1 |
Hazard Codes | Xi | Hazard Note | Irritant/Keep Cold | HS Code | 2918290090 |
| 4-BROMO-3-HYDROXYBENZOIC ACID Usage And Synthesis |
Chemical Properties | Rust Solid | Uses | Brocresine metabolite. Inhibitor of inhibited rat fetal and rat gastric histidine decarboxylase. |
| 4-BROMO-3-HYDROXYBENZOIC ACID Preparation Products And Raw materials |
|