(1-Benzyl-4-piperidinyl)methylamine manufacturers
|
| | (1-Benzyl-4-piperidinyl)methylamine Basic information |
| Product Name: | (1-Benzyl-4-piperidinyl)methylamine | | Synonyms: | 4-PIPERIDINEMETHANAMINE, 1-(PHENYLMETHYL)-;4-AMINOMETHYL-1-BENZYLPIPERIDINE;AKOS B029940;1-BENZYL-PIPERIDIN-4-METHYLAMINE;[(1-BENZYLPIPERIDIN-4-YL)METHYL]AMINE;(1-BENZYL-4-PIPERIDINYL)METHYLAMINE;CHEMBRDG-BB 4009650;C-(1-BENZYL-PIPERIDIN-4-YL)-METHYLAMINE | | CAS: | 88915-26-8 | | MF: | C13H20N2 | | MW: | 204.31 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 88915-26-8.mol |  |
| | (1-Benzyl-4-piperidinyl)methylamine Chemical Properties |
| Boiling point | 125 °C | | density | 1.018±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | pka | 10.13±0.29(Predicted) | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C13H20N2/c14-10-12-6-8-15(9-7-12)11-13-4-2-1-3-5-13/h1-5,12H,6-11,14H2 | | InChIKey | KNUKUWNSGVICSX-UHFFFAOYSA-N | | SMILES | N1(CC2=CC=CC=C2)CCC(CN)CC1 | | CAS DataBase Reference | 88915-26-8(CAS DataBase Reference) |
| | (1-Benzyl-4-piperidinyl)methylamine Usage And Synthesis |
| | (1-Benzyl-4-piperidinyl)methylamine Preparation Products And Raw materials |
|