|
|
| | Methyltris(methylethylketoxime)silane Basic information | | Application |
| | Methyltris(methylethylketoxime)silane Chemical Properties |
| Melting point | -22°C | | Boiling point | 110 °C | | density | 0.982 | | vapor pressure | 0.142Pa at 25℃ | | refractive index | 1.4548 [25°C] | | Fp | 90°C | | Specific Gravity | 0.982 | | Odor | Mild odor | | Water Solubility | 36.63g/L | | Hydrolytic Sensitivity | 7: reacts slowly with moisture/water | | InChI | InChI=1S/C13H27N3O3Si/c1-8-11(4)14-17-20(7,18-15-12(5)9-2)19-16-13(6)10-3/h8-10H2,1-7H3/b14-11-,15-12+,16-13+ | | InChIKey | OGZPYBBKQGPQNU-STFOEXHGSA-N | | SMILES | [Si](C)(O/N=C(\C)/CC)(O/N=C(\C)/CC)O/N=C(/C)\CC | | LogP | 1.69 | | CAS DataBase Reference | 22984-54-9(CAS DataBase Reference) | | EPA Substance Registry System | 2-Butanone, 2,2',2''-[O,O',O''-(methylsilylidyne)trioxime] (22984-54-9) |
| | Methyltris(methylethylketoxime)silane Usage And Synthesis |
| Application | Methyltris(methylethylketoxime)silane is used as a neutral curing agent in silicone sealant formulations. Generally, this silane is used for crosslinking α,ω-silanol polydimethylsiloxanes in the presence of atmospheric moisture.
It is often the main crosslinker of choice for oxime silicone sealants and can be used by itself or in combination with other oxime silanes to provide the sealant with targeted properties (such as desired cure rate, adhesion etc).
| | Chemical Properties | Colorless or yellowish transparent liquid | | Uses | Methyltris(methylethylketoxime)silane can be used as a silane coupling agent and crosslinker.
| | Flammability and Explosibility | Non flammable |
| | Methyltris(methylethylketoxime)silane Preparation Products And Raw materials |
|