- Halfenprox
-
- $1.00 / 1KG
-
2020-02-01
- CAS:111872-58-3
- Min. Order: 1KG
- Purity: Min98% HPLC
- Supply Ability: g/kg/ton
|
| | HALFENPROX Basic information |
| Product Name: | HALFENPROX | | Synonyms: | SIRBON;FUBFENPROX;HALFENPROX;BROFENPROX;ANNIVERSE;2-(4-Bromodifluoromethoxyphenyl)-2-methylpropyl 3-phenoxybenzyl ether;1-[(2-{4-[Bromo(difluoro)methoxy]phenyl}-2-methylpropoxy)methyl]-3-phenoxybenzene;Halfenprox [iso] | | CAS: | 111872-58-3 | | MF: | C24H23BrF2O3 | | MW: | 477.34 | | EINECS: | | | Product Categories: | | | Mol File: | 111872-58-3.mol |  |
| | HALFENPROX Chemical Properties |
| Melting point | <25 °C | | Boiling point | approximate 291℃ | | density | 1.331±0.06 g/cm3(Predicted) | | storage temp. | 0-6°C | | BRN | 11404200 | | Major Application | agriculture environmental | | InChI | 1S/C24H23BrF2O3/c1-23(2,19-11-13-21(14-12-19)30-24(25,26)27)17-28-16-18-7-6-10-22(15-18)29-20-8-4-3-5-9-20/h3-15H,16-17H2,1-2H3 | | InChIKey | WIFXJBMOTMKRMM-UHFFFAOYSA-N | | SMILES | CC(C)(COCC1=CC(=CC=C1)OC2=CC=CC=C2)C3=CC=C(C=C3)OC(F)(F)Br | | CAS DataBase Reference | 111872-58-3 |
| Hazard Codes | T,N | | Risk Statements | 25-50/53 | | Safety Statements | 45-60-61 | | RIDADR | UN2810 - class 6.1 - PG 3 - EHS - Toxic, liquids, organic, n.o.s., HI: all | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 |
| | HALFENPROX Usage And Synthesis |
| Uses | Halfenprox is a pesticide residue in crops. | | Definition | ChEBI: An aromatic ether the is the 3-phenoxybenzyl ether of 2-(4-difluorobromomethoxyphenyl)-2-methylpropanol. |
| | HALFENPROX Preparation Products And Raw materials |
|