|
|
| | N-(2-Hydroxyethyl)-N-methylaniline Basic information |
| | N-(2-Hydroxyethyl)-N-methylaniline Chemical Properties |
| Melting point | 77 °C | | Boiling point | 229 °C (lit.) | | density | 1.06 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.573(lit.) | | Fp | >230 °F | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | form | clear liquid | | pka | 14.79±0.10(Predicted) | | Specific Gravity | 1.071.060 | | color | Light yellow to Brown | | InChI | InChI=1S/C9H13NO/c1-10(7-8-11)9-5-3-2-4-6-9/h2-6,11H,7-8H2,1H3 | | InChIKey | VIIZJXNVVJKISZ-UHFFFAOYSA-N | | SMILES | C(O)CN(C)C1=CC=CC=C1 | | CAS DataBase Reference | 93-90-3(CAS DataBase Reference) | | NIST Chemistry Reference | N-(2-Hydroxyethyl)-N-methylaniline(93-90-3) | | EPA Substance Registry System | Ethanol, 2-(methylphenylamino)- (93-90-3) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 2 | | RTECS | KL7175000 | | TSCA | TSCA listed | | HS Code | 29221990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | N-(2-Hydroxyethyl)-N-methylaniline Usage And Synthesis |
| Chemical Properties | Colorless to yellow liquid | | Uses | Octaacetyl-β-maltose is used to prepare self-reproducing micelles in the preparation of triazole-containing disaccharides. It has also been used as a reactant in the synthesis of neoglycoconjugates through glycosyl aldehydes featuring bioorthogonal oxime bond formation. |
| | N-(2-Hydroxyethyl)-N-methylaniline Preparation Products And Raw materials |
|