- 3-Methylphenethyl alcohol
-
- $15.00 / 1KG
-
2021-08-12
- CAS:1875-89-4
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 3-Methylphenethyl alcohol Basic information |
| | 3-Methylphenethyl alcohol Chemical Properties |
| Boiling point | 242-243 °C (lit.) | | density | 1.002 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.529(lit.) | | Fp | 229 °F | | storage temp. | Sealed in dry,Room Temperature | | pka | 14.97±0.10(Predicted) | | form | clear liquid | | color | Colorless to Almost colorless | | Odor | at 100.00 %. floral rose jasmin muguet lilac woody | | Odor Type | floral | | Cosmetics Ingredients Functions | PERFUMING | | InChI | InChI=1S/C9H12O/c1-8-3-2-4-9(7-8)5-6-10/h2-4,7,10H,5-6H2,1H3 | | InChIKey | KWHVBVJDKLSOTB-UHFFFAOYSA-N | | SMILES | C1(CCO)=CC=CC(C)=C1 | | LogP | 2.055 (est) | | CAS DataBase Reference | 1875-89-4(CAS DataBase Reference) | | NIST Chemistry Reference | Benzeneethanol, 3-methyl-(1875-89-4) | | EPA Substance Registry System | 3-Methylbenzeneethanol (1875-89-4) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29062990 | | Storage Class | 10 - Combustible liquids |
| | 3-Methylphenethyl alcohol Usage And Synthesis |
| Chemical Properties | CLEAR SLIGHTLY YELLOW LIQUID | | Uses | 3-Methylphenethyl alcohol (2-(3-methylphenyl) ethanol) is commonly used as fragrance ingredient. |
| | 3-Methylphenethyl alcohol Preparation Products And Raw materials |
|