|
|
| | ((1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one Basic information |
| | ((1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one Chemical Properties |
| Melting point | 94-97 °C(lit.) | | Boiling point | 319.3±0.0 °C(Predicted) | | density | 1.198±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly) | | pka | 15.48±0.20(Predicted) | | form | Crystals or Crystalline Powder | | color | Off-white to beige | | Optical Rotation | [α]20/D 565°, c = 1 in chloroform | | BRN | 4230721 | | InChI | InChI=1S/C6H7NO/c8-6-4-1-2-5(3-4)7-6/h1-2,4-5H,3H2,(H,7,8)/t4-,5+/m1/s1 | | InChIKey | DDUFYKNOXPZZIW-UHNVWZDZSA-N | | SMILES | [C@@]12([H])C[C@@]([H])(C=C1)C(=O)N2 | | CAS DataBase Reference | 79200-56-9 |
| Hazard Codes | Xn | | Risk Statements | 22-41-43 | | Safety Statements | 24-26-37/39 | | WGK Germany | 1 | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Sens. 1 |
| | ((1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one Usage And Synthesis |
| Chemical Properties | OFF-WHITE TO BEIGE CRYSTALS OR CRYSTALLINE POWDER | | Uses | (1R)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one can be used as a precursor to prepare:
- Amino-peramivir, a potent neuraminidase inhibitor.
- Five membered analogs of 4-amino-5-halopentanoic acids as potential GABA aminotransferase (GABA-AT) inactivators.
| | Uses | ((1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one is an abacavir intermediate. It is used as an intermediate in the synthesis of carbocyclic sugar amines, carbanucleosides, and carbocyclic dinucleotide analogues. | | General Description | (1R)-(-)-2-Azabicyclo[2.2.1]hept-5-en-3-one is a bicyclic γ-lactam. |
| | ((1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one Preparation Products And Raw materials |
|