|
|
| | 2-tert-Butylanthraquinone Basic information |
| | 2-tert-Butylanthraquinone Chemical Properties |
| Melting point | 98-100 °C (lit.) | | Boiling point | 367.55°C (rough estimate) | | density | 1.0897 (rough estimate) | | refractive index | 1.5200 (estimate) | | solubility | almost transparency in hot Methanol | | form | powder to crystal | | color | Light yellow to Yellow to Orange | | InChI | InChI=1S/C18H16O2/c1-18(2,3)11-8-9-14-15(10-11)17(20)13-7-5-4-6-12(13)16(14)19/h4-10H,1-3H3 | | InChIKey | YTPSFXZMJKMUJE-UHFFFAOYSA-N | | SMILES | C1=C2C(C(=O)C3=C(C2=O)C=CC=C3)=CC=C1C(C)(C)C | | LogP | 4.124 (est) | | CAS DataBase Reference | 84-47-9(CAS DataBase Reference) | | NIST Chemistry Reference | Anthraquinone, 2-tert-butyl(84-47-9) | | EPA Substance Registry System | 9,10-Anthracenedione, 2-(1,1-dimethylethyl)- (84-47-9) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | RIDADR | 3077 | | WGK Germany | 3 | | RTECS | CB0487500 | | TSCA | Yes | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29146990 |
| | 2-tert-Butylanthraquinone Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 2-tert-Butylanthraquinone is used in application of 2-substituted anthraquinone derivatives for the preparation of pharmaceuticals for the treatment of Candida albicans infection. |
| | 2-tert-Butylanthraquinone Preparation Products And Raw materials |
|