|
|
| | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one Basic information |
| | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one Chemical Properties |
| Melting point | 107-109 °C(lit.) | | alpha | 51 º (c=1, chloroform) | | Boiling point | 358.3±27.0 °C(Predicted) | | density | 1.03±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | almost transparency in Methanol | | form | powder to crystal | | pka | 12.86±0.60(Predicted) | | color | White to Almost white | | Optical Rotation | [α]20/D +51°, c = 1 in chloroform | | InChI | InChI=1S/C13H25NO4Si/c1-8(18-19(6,7)13(3,4)5)10-11(16)14-12(10)17-9(2)15/h8,10,12H,1-7H3,(H,14,16)/t8-,10+,12-/m1/s1 | | InChIKey | GWHDKFODLYVMQG-UBHAPETDSA-N | | SMILES | N1[C@H](OC(C)=O)[C@@H]([C@H](O[Si](C(C)(C)C)(C)C)C)C1=O | | CAS DataBase Reference | 76855-69-1(CAS DataBase Reference) |
| Hazard Codes | Xi,N | | Risk Statements | 36-43-51/53 | | Safety Statements | 24-26-37-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | HazardClass | 9 | | PackingGroup | III | | HS Code | 29337900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Aquatic Chronic 2 Eye Irrit. 2 Skin Sens. 1 |
| | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one is an acetoxyazetidinone derivative used as an intermediate in the preparation of carbapenem antibiotics. | | Purification Methods | Purify it by chromatography on silica gel (3 x 14cm) for 50g of ester using 20% EtOAc in n-hexane. The eluate is evaporated, and the residue is recrystallised from hexane (white fluffy crystals). [Leanza et al. Tetrahedron 39 2505 1983.] |
| | (3S,4R)-4-Acetoxy-3-[(R)-1-(tert-butyldimethylsilyloxy)ethyl]azetidin-2-one Preparation Products And Raw materials |
|