|
|
| | 7-CHLORO-4-QUINAZOLINOL Basic information |
| | 7-CHLORO-4-QUINAZOLINOL Chemical Properties |
| Melting point | 251-253 °C | | Boiling point | 331.7±44.0 °C(Predicted) | | density | 1.50±0.1 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 0.36±0.20(Predicted) | | Appearance | Off-white to light brown Solid | | InChI | InChI=1S/C8H5ClN2O/c9-5-1-2-6-7(3-5)10-4-11-8(6)12/h1-4H,(H,10,11,12) | | InChIKey | PMLONMIODRHERC-UHFFFAOYSA-N | | SMILES | N1C2=C(C=CC(Cl)=C2)C(=O)NC=1 |
| | 7-CHLORO-4-QUINAZOLINOL Usage And Synthesis |
| Synthesis Reference(s) | Journal of the American Chemical Society, 68, p. 1305, 1946 DOI: 10.1021/ja01211a058 | | Synthesis | The general procedure for the synthesis of 7-chloro-4(3H)-quinazolinone from formamidine acetate and 2-amino-4-chlorobenzoic acid was as follows: 10 g of 2-amino-4-chlorobenzoic acid (BB1) and 8 g of formamidine acetate (1.3 eq.) were added to a 100 ml eggplant flask and mixed thoroughly. The mixture was placed in a microwave reactor and reacted at 60% power for 4 min. After completion of the reaction, it was cooled to room temperature, 30 ml of water was added, stirred and the solid product was collected by filtration. The resulting product was 7-chloro-4(3H)-quinazolinone (BB2) in a yield of 10 g with 95% yield. | | References | [1] Patent: CN103570738, 2016, B. Location in patent: Paragraph 0303; 0304; 0306
[2] Patent: CN103382182, 2016, B. Location in patent: Paragraph 0272-0275
[3] Patent: WO2012/88712, 2012, A1. Location in patent: Page/Page column 16
[4] MedChemComm, 2015, vol. 6, # 1, p. 222 - 229 |
| | 7-CHLORO-4-QUINAZOLINOL Preparation Products And Raw materials |
|