|
|
| | Methyl 3-cyclopentenecarboxylate Basic information |
| Product Name: | Methyl 3-cyclopentenecarboxylate | | Synonyms: | METHYL 3-CYCLOPENTENECARBOXYLATE;Methyl3-Cyclopentene-1-CarBonate;Methyl-3-cyclopentene-1-carboxylate;3-Cyclopentene CarboxylicAcid Methyl Ester;3-Cyclopentene-1-Carboxylic AcidMethyl Ester;Methyl 3-cyclopentenecarboxylate ,98%;3-cyclopentene-1-Methyl;Methyl cyclopent-3-enecarboxylate | | CAS: | 58101-60-3 | | MF: | C7H10O2 | | MW: | 126.15 | | EINECS: | | | Product Categories: | pharmacetical | | Mol File: | 58101-60-3.mol |  |
| | Methyl 3-cyclopentenecarboxylate Chemical Properties |
| Boiling point | 74 °C(Press: 24 Torr) | | density | 1.031 g/mL at 25 °C | | Fp | 48°(118°F) | | refractive index | 1.4500 | | storage temp. | 2-8°C | | form | Liquid | | color | Colorless to pale brown | | InChI | InChI=1S/C7H10O2/c1-9-7(8)6-4-2-3-5-6/h2-3,6H,4-5H2,1H3 | | InChIKey | CEOILRYKIJRPBZ-UHFFFAOYSA-N | | SMILES | C1(C(OC)=O)CC=CC1 | | CAS DataBase Reference | 58101-60-3(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 10-41 | | Safety Statements | 24/25-36/39 | | RIDADR | UN 1993C 3 / PGIII | | WGK Germany | 3 | | HazardClass | 3 | | HS Code | 2916200090 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Eye Dam. 1
Flam. Liq. 3 |
| | Methyl 3-cyclopentenecarboxylate Usage And Synthesis |
| Uses | Methyl 3-Cyclopentene-1-carboxylate has been used as a reactant in the preparation of (silyloxy)methylcyclopentanone as a key intermediate of sphingosine phosphate receptor agonists. | | Synthesis | At 0 °C and under nitrogen protection, 3-cyclopentenecarboxylic acid (10 g, 89 mmol) was dissolved in dichloromethane (100 mL), followed by the addition of 1,1'-carbonyl diimidazole (43 g, 267 mmol). The reaction mixture was stirred at room temperature for 4 hours, after which methanol (100 mL) was added. Stirring of the reaction mixture was continued overnight. The solvent was removed by low temperature evaporation to afford methyl 3-cyclopentene-1-carboxylate (11.2 g, 99% yield). | | References | [1] Patent: US2007/254952, 2007, A1. Location in patent: Page/Page column 35
[2] Nucleosides, Nucleotides and Nucleic Acids, 2001, vol. 20, # 4-7, p. 661 - 664
[3] ChemMedChem, 2011, vol. 6, # 9, p. 1559 - 1565
[4] Bioorganic and Medicinal Chemistry Letters, 2007, vol. 17, # 19, p. 5336 - 5339 |
| | Methyl 3-cyclopentenecarboxylate Preparation Products And Raw materials |
|