- Ethyl 2-bromovalerate
-
- $30.00
-
2025-06-27
- CAS:615-83-8
- Min. Order: 50KG
- Purity: 99%
- Supply Ability: 500000kg
|
| | Ethyl 2-bromovalerate Basic information |
| | Ethyl 2-bromovalerate Chemical Properties |
| Boiling point | 190-192 °C(lit.) | | density | 1.226 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.448(lit.) | | Fp | 171 °F | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) | | form | Liquid | | Specific Gravity | 1.22 | | color | Clear colorless | | Water Solubility | insoluble | | BRN | 1098901 | | InChI | InChI=1S/C7H13BrO2/c1-3-5-6(8)7(9)10-4-2/h6H,3-5H2,1-2H3 | | InChIKey | ORSIRXYHFPHWTN-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(Br)CCC | | CAS DataBase Reference | 615-83-8(CAS DataBase Reference) | | NIST Chemistry Reference | Ethyl 2-bromovalerate(615-83-8) |
| Hazard Codes | C,Xi | | Risk Statements | 34-36/37-36/37/38 | | Safety Statements | 23-26-27-36/37/39-45-24/25 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29159080 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B
STOT SE 3 |
| | Ethyl 2-bromovalerate Usage And Synthesis |
| Chemical Properties | clear colorless liquid | | Uses | Ethyl 2-Bromovalerate, is an organic building block used for the synthesis of various pharmaceutical compounds. |
| | Ethyl 2-bromovalerate Preparation Products And Raw materials |
|