| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:(+)-Sativene
CAS:3650-28-0
Purity:>=98.0% (sum of enantiomers, GC) Package:100MG Remarks:84590-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:(+)-Sativene >=98.0% (sum of enantiomers, GC)
CAS:3650-28-0
Purity:>=98.0% (sum of enantiomers, GC) Package:100mg Remarks:NULL
|
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Email: |
ordercn@merckgroup.com |
| Products Intro: |
Product Name:(+)-Sativene
CAS:3650-28-0
|
|
| | (+)-SATIVEN Basic information |
| Product Name: | (+)-SATIVEN | | Synonyms: | (1S,3aα,7aα)-Octahydro-4-methyl-8-methylene-7β-isopropyl-1β,4β-methano-1H-indene;(+)-SATIVEN;(+)-Sativene;C15 H24, 1,4-methano-1H-indene, Octahydro-4-methyl-8-methylen-7-(1-methylethyl)-;1,4-Methano-1H-indene, octahydro-4-methyl-8-methylene-7-(1-methylethyl)-, (1S,3aR,4S,7S,7aS)-;(+)-Sativene >=98.0% (sum of enantiomers, GC);3650-28-0 (+)-SATIVEN;(+)-Sativene | | CAS: | 3650-28-0 | | MF: | C15H24 | | MW: | 204.35 | | EINECS: | | | Product Categories: | | | Mol File: | 3650-28-0.mol |  |
| | (+)-SATIVEN Chemical Properties |
| Boiling point | 256 °C (lit.) | | density | 0.921 g/mL at 20 °C (lit.) | | refractive index | n20/D 1.496 | | storage temp. | 2-8°C | | Optical Rotation | [α]20/D +176±3°, c = 10% in ethanol | | BRN | 6566323 | | InChI | 1S/C15H24/c1-9(2)11-7-8-15(4)10(3)12-5-6-13(15)14(11)12/h9,11-14H,3,5-8H2,1-2,4H3/t11-,12+,13+,14-,15+/m0/s1 | | InChIKey | VOBBUADSYROGAT-VYDRJRHOSA-N | | SMILES | [H][C@]12CC[C@]3([H])[C@@]1([H])[C@@H](CC[C@]3(C)C2=C)C(C)C | | LogP | 6.166 (est) |
| WGK Germany | 3 | | F | 10 | | Storage Class | 10 - Combustible liquids |
| | (+)-SATIVEN Usage And Synthesis |
| | (+)-SATIVEN Preparation Products And Raw materials |
|