- 2,6-DICHLOROTHIOPHENOL
-
- $15.00 / 1KG
-
2021-08-12
- CAS:24966-39-0
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
- 2,6-DICHLOROTHIOPHENOL
-
- $1.00 / 1KG
-
2019-07-06
- CAS:24966-39-0
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: Customized
|
| | 2,6-DICHLOROTHIOPHENOL Basic information |
| Product Name: | 2,6-DICHLOROTHIOPHENOL | | Synonyms: | 2,6-DICHLOROTHIOPHENOL;2,6-Dichlorophenyl mercaptan;Benzenethiol, 2,6-dichloro-;2,6-Dichlorothiophenol 98%;2,6-DICHLOROTHIOPHENOL / 2,6-DICHLOROBENZENETHIOL;2,6-Dichlorobenzenethiol, 2,6-Dichlorophenyl mercaptan;2,6-DICHLOROTHIOPHEN;2,6 - Dichloro Thiophenole | | CAS: | 24966-39-0 | | MF: | C6H4Cl2S | | MW: | 179.07 | | EINECS: | 416-720-7 | | Product Categories: | Phenol&Thiophenol&Mercaptan;Phenoles and thiophenoles | | Mol File: | 24966-39-0.mol |  |
| | 2,6-DICHLOROTHIOPHENOL Chemical Properties |
| Melting point | 48-50 °C(lit.) | | Boiling point | 119-120 °C (10 mmHg) | | density | 1.3905 (estimate) | | Fp | >230 °F | | storage temp. | Store below +30°C. | | form | solid | | pka | 5.17±0.50(Predicted) | | Appearance | White to off-white Solid | | Sensitive | Stench | | BRN | 2082400 | | InChI | InChI=1S/C6H4Cl2S/c7-4-2-1-3-5(8)6(4)9/h1-3,9H | | InChIKey | JBISHCXLCGVPGW-UHFFFAOYSA-N | | SMILES | C1(S)=C(Cl)C=CC=C1Cl | | CAS DataBase Reference | 24966-39-0(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 20/21/22-36/37/38 | | Safety Statements | 26-37/39-36 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | Hazard Note | Harmful/Stench | | PackingGroup | III | | HS Code | 29309090 | | Toxicity | LD50 orally in Rabbit: 2400 mg/kg |
| | 2,6-DICHLOROTHIOPHENOL Usage And Synthesis |
| Chemical Properties | yellow crystals or chunks |
| | 2,6-DICHLOROTHIOPHENOL Preparation Products And Raw materials |
|