- 2-CHLORO-5-FORMYL-4-PICOLINE
-
- $5.00 / 1KG
-
2024-04-09
- CAS:884495-38-9
- Min. Order: 1KG
- Purity: 98%
- Supply Ability: g-kg-tons, free sample is available
|
| | 6-Chloro-4-methylnicotinaldehyde Basic information |
| Product Name: | 6-Chloro-4-methylnicotinaldehyde | | Synonyms: | 2-CHLORO-5-FORMYL-4-PICOLINE;6-Chloro-4-methyl-3-pyridinecarboxaldehyde;2-chloro-5-forMyl-4-picoline(6-Chloro-4-Methyl-3-pyridinecarboxaldehyde);6-Chloro-4-Methyl-pyridine-3-carbaldehyde;3-Pyridinecarboxaldehyde, 6-chloro-4-Methyl-;CML-012;2-CHLORO-5-FORMYL-4-PICOLINE ISO 9001：2015 REACH;KML-84 | | CAS: | 884495-38-9 | | MF: | C7H6ClNO | | MW: | 155.58 | | EINECS: | | | Product Categories: | | | Mol File: | 884495-38-9.mol |  |
| | 6-Chloro-4-methylnicotinaldehyde Chemical Properties |
| Boiling point | 277.6±35.0 °C(Predicted) | | density | 1.269±0.06 g/cm3(Predicted) | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | pka | -1.05±0.10(Predicted) | | form | powder | | color | Beige | | InChI | InChI=1S/C7H6ClNO/c1-5-2-7(8)9-3-6(5)4-10/h2-4H,1H3 | | InChIKey | GDOVQVRMRKHPNI-UHFFFAOYSA-N | | SMILES | C1=NC(Cl)=CC(C)=C1C=O |
| Hazard Codes | Xn | | Risk Statements | 22-36 | | Safety Statements | 26 | | HS Code | 2933399990 |
| | 6-Chloro-4-methylnicotinaldehyde Usage And Synthesis |
| | 6-Chloro-4-methylnicotinaldehyde Preparation Products And Raw materials |
|