- 4-Amino-2-methylphenol
-
- $15.00 / 1KG
-
2021-08-12
- CAS:2835-96-3
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | 4-Amino-2-methylphenol Basic information |
| Product Name: | 4-Amino-2-methylphenol | | Synonyms: | 4-AMINO-2-METHYLPHENOL;4-HYDROXY-3-METHYLANILINE;2-METHYL-4-AMINOPHENOL;4-HYDROXY-3-METHYLANILIN 97%;5-Amino-2-hydroxytoluene;4-Amino-o-cresol (OH=1);4-AMINO-O-CRESOL 98+%;4-Amino-2-methylphen | | CAS: | 2835-96-3 | | MF: | C7H9NO | | MW: | 123.15 | | EINECS: | 220-619-1 | | Product Categories: | | | Mol File: | 2835-96-3.mol |  |
| | 4-Amino-2-methylphenol Chemical Properties |
| Melting point | 174-176 °C(lit.) | | Boiling point | 229.26°C (rough estimate) | | density | 1.0877 (rough estimate) | | refractive index | 1.5706 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,Room temperature | | solubility | soluble in Methanol | | form | powder to crystal | | pka | 10.57±0.18(Predicted) | | color | White to Gray to Brown | | InChI | InChI=1S/C7H9NO/c1-5-4-6(8)2-3-7(5)9/h2-4,9H,8H2,1H3 | | InChIKey | HDGMAACKJSBLMW-UHFFFAOYSA-N | | SMILES | C1(O)=CC=C(N)C=C1C | | CAS DataBase Reference | 2835-96-3(CAS DataBase Reference) | | EPA Substance Registry System | 4-Amino-o-cresol (2835-96-3) |
| | 4-Amino-2-methylphenol Usage And Synthesis |
| Chemical Properties | beige crystals |
| | 4-Amino-2-methylphenol Preparation Products And Raw materials |
|