|
|
| | 2'-Deoxyguanosine-5'-triphosphate trisodium salt Basic information |
| Product Name: | 2'-Deoxyguanosine-5'-triphosphate trisodium salt | | Synonyms: | Guanosine 5'-(tetrahydrogen triphosphate), 2'-deoxy-, trisodium salt;[[[5-[(2-AMINO-6-OXO-1,9-DIHYDROPURIN-9-YL)]-3-HYDROXY-TETRAHYDROFURAN-2-YL]METHOXY-HYDROXY-PHOSPHINOYL]OXY-HYDROXY-PHOSPHINOYL]OXYPHOSPHONIC ACID;8-AZIDOGUANOSINE 2'-DEOXYTRIPHOSPHATE;2'-DEOXYGUANOSINE 5'-TRIPHOSPHATE*SODIUM 100 MM AQU;2'-DEOXYGUANOSINE 5'-TRIPHOSPHATE*SODIUM PCR REAGEN;2'-Deoxyguanosine-5'-triphosph;dgtp-na3;dGTP,3Na | | CAS: | 93919-41-6 | | MF: | C10H17N5NaO13P3 | | MW: | 531.18 | | EINECS: | 300-026-5 | | Product Categories: | nucleoside;Nucleic acids;Pharmaceutical;PCR;dNTP;Nucleotide | | Mol File: | 93919-41-6.mol |  |
| | 2'-Deoxyguanosine-5'-triphosphate trisodium salt Chemical Properties |
| Melting point | >0°C | | storage temp. | -20°C | | solubility | PBS (pH 7.2): 5 mg/mL | | form | solid | | color | colorless | | InChIKey | IWGGLKOTEOCWQP-BQHLMXRXSA-K | | SMILES | O=C1NC(N)=NC2N([C@H]3C[C@H](O)[C@@H](COP(O)(=O)OP(O)(=O)OP(O)(O)=O)O3)C=NC1=2.[NaH] |&1:8,10,12,r| | | CAS DataBase Reference | 93919-41-6(CAS DataBase Reference) |
| | 2'-Deoxyguanosine-5'-triphosphate trisodium salt Usage And Synthesis |
| Description | 2′-Deoxyguanosine 5′-triphosphate (dGTP) is made of a guanine nucleobase attached to deoxyribose and a 5′-hydroxyl on the sugar linked to a chain of three phosphate residues. It is used by the cells for the synthesis of DNA with the help of DNA polymerase.
| | Chemical Properties | White amorphous powder | | Uses | 2′-Deoxyguanosine 5′-triphosphate trisodium salt is utilized for methods such as DNA sequencing, PCR and other DNA polymerase based DNA synthesis and repair techniques. | | General Description | dGTP, PCR Grade, is a 100 mM clear, colorless solution of the sodium salt (pH 8.3). PCR Grade nucleotides from Roche are specially manufactured and purified to the highest possible chemical purity. PCR Grade nucleotides contain at least 99% of the relevant deoxynucleoside-triphosphate (dNTP) and less than 0.9% deoxynucleoside-diphosphate (dNDP). | | Biochem/physiol Actions | 2′-Deoxyguanosine 5′-triphosphate is used in vivo synthesis for the synthesis of DNA via DNA polymerases. | | storage |
Store at -20°C. Store under desiccating conditions. The product can be stored for up to 12 months.
|
| | 2'-Deoxyguanosine-5'-triphosphate trisodium salt Preparation Products And Raw materials |
|