|
|
| | INDOPHENOL BLUE Basic information |
| Product Name: | INDOPHENOL BLUE | | Synonyms: | ALPHA-NAPHTHOL BLUE;N-(4-DIMETHYLAMINOPHENYL)-1,4-NAPHTHOQUINONEIMINE;N-(P-DIMETHYLAMINO)PHENYL-1,4-NAPHTHOQUINONEIMINE;INDOPHENOL BLUE;INDOPHENOL;CI 49700;4-[[4-(dimethylamino)phenyl]imino]-1(4h)-naphthalenon;4-[[4-(dimethylamino)phenyl]imino]naphthalen-1(4H)-one | | CAS: | 132-31-0 | | MF: | C18H16N2O | | MW: | 276.33 | | EINECS: | 205-056-1 | | Product Categories: | G-H-I;Stains and Dyes;Stains&Dyes, A to | | Mol File: | 132-31-0.mol |  |
| | INDOPHENOL BLUE Chemical Properties |
| Melting point | 168-170 °C(lit.) | | Boiling point | 427.7±45.0 °C(Predicted) | | density | 1.11±0.1 g/cm3(Predicted) | | storage temp. | room temp | | Colour Index | 49700 | | pka | 3.18±0.12(Predicted) | | form | powder to crystal | | color | Gray to Dark purple to Black | | λmax | 606 nm | | BRN | 2379761 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | diagnostic assay manufacturing
hematology
histology | | InChI | 1S/C18H16N2O/c1-20(2)14-9-7-13(8-10-14)19-17-11-12-18(21)16-6-4-3-5-15(16)17/h3-12H,1-2H3/b19-17+ | | InChIKey | VRZJGENLTNRAIG-HTXNQAPBSA-N | | SMILES | CN(C)c1ccc(cc1)\N=C2/C=CC(=O)c3ccccc23 | | CAS DataBase Reference | 132-31-0 | | EPA Substance Registry System | 1(4H)-Naphthalenone, 4-[[4-(dimethylamino)phenyl]imino]- (132-31-0) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 3204.15.8000 | | Storage Class | 11 - Combustible Solids |
| | INDOPHENOL BLUE Usage And Synthesis |
| Chemical Properties | black powder | | Uses | Indophenol is an artificial blue metachromatic dye. The formation of Indophenol can be used to determine ammonia and paracetamol by spectrophotometry. Dyes and metabolites. |
| | INDOPHENOL BLUE Preparation Products And Raw materials |
|