| Company Name: |
shanghai honghe yiyao Gold
|
| Tel: |
18352536981 |
| Email: |
653603901@qq.com |
| Products Intro: |
Product Name:2-Methyl-2-azaspiro[3.3]Heptan-6-amine dihydrochloride
CAS:2306276-66-2
Purity:99% Package:1g/RMB 860;5g/RMB 3318;25g/RMB 12980
|
| Company Name: |
JW & Y Pharmlab Co., Ltd.
|
| Tel: |
021-64340559 13651849907; |
| Email: |
xinyu_shi@jwypharmlab.com.cn |
| Products Intro: |
Product Name:2-Methyl-2-aza-spiro[3.3]hept-6-ylamine dihydrochloride
CAS:2306276-66-2
Purity:0.96 Package:1g;5g;25g;100g;250g等可分装
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 18068836627 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
CAS:2306276-66-2
Purity:95% Package:1g;5g;10g
|
|
| | 2-methyl-2-azaspiro[3.3]heptan-6-amine dihydrochloride Basic information |
| | 2-methyl-2-azaspiro[3.3]heptan-6-amine dihydrochloride Chemical Properties |
| storage temp. | Store at room temperature, keep dry and cool | | Appearance | White to off-white Solid | | InChI | InChI=1S/C7H14N2.ClH/c1-9-4-7(5-9)2-6(8)3-7;/h6H,2-5,8H2,1H3;1H | | InChIKey | XTBMLECWUPESRZ-UHFFFAOYSA-N | | SMILES | NC1CC2(CN(C)C2)C1.Cl |
| | 2-methyl-2-azaspiro[3.3]heptan-6-amine dihydrochloride Usage And Synthesis |
| | 2-methyl-2-azaspiro[3.3]heptan-6-amine dihydrochloride Preparation Products And Raw materials |
|