| Company Name: |
Creative Enzymes |
| Tel: |
1-516-855-7709 |
| Email: |
info@creative-enzymes.com |
|
| | CHOLETH-10 Basic information |
| Product Name: | CHOLETH-10 | | Synonyms: | CHOLETH-10;CHOLETH-20;Poly(oxy-1,2-ethanediyl), .alpha.-(3.beta.)-cholest-5-en-3-yl-.omega.-hydroxy-;polyoxyethylene-24-cholesteryl ether;POLYOXYETHYLENE24CHOLESTEROLETHER;CHOLETH;POLYOXYETHYLENE32CHOLESTERYLETHER;5-Cholestene-3.beta.-polyethyleneoxide | | CAS: | 27321-96-6 | | MF: | (C2H4O)nC27H46O | | MW: | 430.7061 | | EINECS: | | | Product Categories: | | | Mol File: | 27321-96-6.mol |  |
| | CHOLETH-10 Chemical Properties |
| storage temp. | -20°C | | form | methylene chloride solution | | Cosmetics Ingredients Functions | SURFACTANT - CLEANSING
SURFACTANT - EMULSIFYING | | Cosmetic Ingredient Review (CIR) | CHOLETH-10 (27321-96-6) | | InChI | 1S/C29H50O2/c1-20(2)7-6-8-21(3)25-11-12-26-24-10-9-22-19-23(31-18-17-30)13-15-28(22,4)27(24)14-16-29(25,26)5/h9,20-21,23-27,30H,6-8,10-19H2,1-5H3 | | InChIKey | NPYXBHZQVNRAOF-UHFFFAOYSA-N | | SMILES | O(C1CCC2(C3C(C4C(C(CC4)C(CCCC(C)C)C)(CC3)C)CC=C2C1)C)CCO | | LogP | 9.798 (est) | | EPA Substance Registry System | Poly(oxy-1,2-ethanediyl), .alpha.-(3.beta.)-cholest-5-en-3-yl-.omega.-hydroxy- (27321-96-6) |
| WGK Germany | WGK 2 | | TSCA | TSCA listed | | Hazard Classifications | Carc. 2
Eye Irrit. 2
Skin Irrit. 2
STOT SE 3 |
| | CHOLETH-10 Usage And Synthesis |
| Uses | Chol-PEG is a nonionic surfactant vesicles and can be used for a blood-persistent drug delivery system[1][2]. | | Biological Activity | PEG-cholesterol is widely used for cationic DNA transfection studies, and preparation of liposomes for encapsulated drug delivery. | | References | [1] Yang DB, et, al. Synthesis and application of poly(ethylene glycol)-cholesterol (Chol-PEGm) conjugates in physicochemical characterization of nonionic surfactant vesicles. Colloids Surf B Biointerfaces. 2008 Jun 1;63(2):192-9. DOI:10.1016/j.colsurfb.2007.11.019
[2] Barnard A, et, al. Effects of a PEG additive on the biomolecular interactions of self-assembled dendron nanostructures. Org Biomol Chem. 2012 Nov 14;10(42):8403-9. DOI:10.1039/c2ob26584b |
| | CHOLETH-10 Preparation Products And Raw materials |
|