- 4-hydroxyphenyl acetate
-
- $0.00 / 25kg
-
2023-11-01
- CAS:3233-32-7
- Min. Order: 1kg
- Purity: 99.0%min
- Supply Ability: 10000kg
|
| | 4-hydroxyphenyl acetate Basic information |
| Product Name: | 4-hydroxyphenyl acetate | | Synonyms: | 4-hydroxyphenyl acetate;4-Acetoxyphenol;4-Acetyloxyphenol;Acetic acid 4-hydroxyphenyl;Hydroquinone 1-acetate;(4-hydroxyphenyl) ethanoate;acetic acid (4-hydroxyphenyl) ester;1-acetate | | CAS: | 3233-32-7 | | MF: | C8H8O3 | | MW: | 152.15 | | EINECS: | | | Product Categories: | | | Mol File: | 3233-32-7.mol |  |
| | 4-hydroxyphenyl acetate Chemical Properties |
| Melting point | 62-63 °C | | Boiling point | 269.3±23.0 °C(Predicted) | | density | 1.212±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Sparingly), Methanol (Slightly) | | form | Solid | | pka | 9.55±0.26(Predicted) | | color | Off-White to Pale Beige | | InChI | InChI=1S/C8H8O3/c1-6(9)11-8-4-2-7(10)3-5-8/h2-5,10H,1H3 | | InChIKey | HBMCQTHGYMTCOF-UHFFFAOYSA-N | | SMILES | C1(OC(=O)C)=CC=C(O)C=C1 |
| | 4-hydroxyphenyl acetate Usage And Synthesis |
| Uses | 4-Acetoxyphenol is a differential urinary metabolite related with severity of major depressive disorder. | | Definition | ChEBI: 4-hydroxyphenyl acetate is a phenyl acetate obtained by formal condensation of the carboxy group of acetic acid with one of the hydroxy groups of hydroquinone. It has a role as a mouse metabolite. It is an acetate ester and a member of phenyl acetates. It is functionally related to a hydroquinone. |
| | 4-hydroxyphenyl acetate Preparation Products And Raw materials |
|