|
|
| | tert-Butyldimethylsilyl (R)-(-)-glycidyl ether Basic information |
| | tert-Butyldimethylsilyl (R)-(-)-glycidyl ether Chemical Properties |
| Boiling point | 195-199 °C/760 mmHg | | density | 0.870 g/mL at 25 °C | | refractive index | n20/D 1.4310 | | Fp | 74 °C | | storage temp. | 2-8°C | | form | liquid | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | [α]22/D -7.0° | | InChI | InChI=1S/C9H20O2Si/c1-9(2,3)12(4,5)11-7-8-6-10-8/h8H,6-7H2,1-5H3/t8-/m1/s1 | | InChIKey | YANSSVVGZPNSKD-MRVPVSSYSA-N | | SMILES | O1C[C@@H]1CO[Si](C(C)(C)C)(C)C |
| RIDADR | NA 1993 / PGIII | | WGK Germany | 3 |
| | tert-Butyldimethylsilyl (R)-(-)-glycidyl ether Usage And Synthesis |
| | tert-Butyldimethylsilyl (R)-(-)-glycidyl ether Preparation Products And Raw materials |
|