- ethyl 2-cyanopropionate
-
- $15.00 / 1KG
-
2021-07-02
- CAS:1572-99-2
- Min. Order: 1KG
- Purity: 99%+ HPLC
- Supply Ability: Monthly supply of 1 ton
|
| | Ethyl 2-cyanopropanoate Basic information |
| Product Name: | Ethyl 2-cyanopropanoate | | Synonyms: | Cyanopropionicacidethylester;Propanoic acid, 2-cyano-, ethyl ester;2-CYANOPROPIONIC ACID ETHYL ESTER 95+%;2-Cyanopropanoic acid ethyl ester;2-Cyanopropionic acid ethyl;2-CYANOPROPIONIC ACID ETHYL ESTER;ETHYL 2-CYANOPROPIONATE;Ethyl 2-cyanopropanoate | | CAS: | 1572-99-2 | | MF: | C6H9NO2 | | MW: | 127.14 | | EINECS: | 216-393-9 | | Product Categories: | | | Mol File: | 1572-99-2.mol |  |
| | Ethyl 2-cyanopropanoate Chemical Properties |
| Boiling point | 193 °C | | density | 1,01 g/cm3 | | refractive index | 1.4130-1.4150 | | Fp | 96°C | | storage temp. | Inert atmosphere,Room Temperature | | form | clear liquid | | color | Colorless to Light yellow | | InChI | InChI=1S/C6H9NO2/c1-3-9-6(8)5(2)4-7/h5H,3H2,1-2H3 | | InChIKey | MIHRVXYXORIINI-UHFFFAOYSA-N | | SMILES | C(OCC)(=O)C(C#N)C | | CAS DataBase Reference | 1572-99-2 |
| | Ethyl 2-cyanopropanoate Usage And Synthesis |
| Chemical Properties | Colorless to light yellow liquid | | Uses | Ethyl 2-Cyanopropanoate is a building block used in many organic reactions such as the preparation of highly substituted benzenes. | | Definition | ChEBI: Ethyl 2-cyanopropionate is an alpha-substituted cyanoacetate ester and an ethyl ester. | | Synthesis Reference(s) | Synthetic Communications, 23, p. 2323, 1993 DOI: 10.1080/00397919308013790 |
| | Ethyl 2-cyanopropanoate Preparation Products And Raw materials |
|