- 4-Chloro-3-nitrocinnamic acid
-
- $100.00 / 1KG
-
2025-09-25
- CAS:20797-48-2
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: g-kg-tons, free sample is available
|
| | 4-Chloro-3-nitrocinnamic acid Basic information |
| | 4-Chloro-3-nitrocinnamic acid Chemical Properties |
| Melting point | 188-190 °C(lit.) | | Boiling point | 408.6±35.0 °C(Predicted) | | density | 1.4751 (rough estimate) | | refractive index | 1.6000 (estimate) | | storage temp. | Storage temp. 2-8°C | | pka | 4.03±0.10(Predicted) | | form | powder to crystal | | color | Light yellow to Brown | | InChI | InChI=1S/C9H6ClNO4/c10-7-3-1-6(2-4-9(12)13)5-8(7)11(14)15/h1-5H,(H,12,13) | | InChIKey | QBDALTIMHOITIU-DUXPYHPUSA-N | | SMILES | C(O)(=O)C=CC1=CC=C(Cl)C([N+]([O-])=O)=C1 | | CAS DataBase Reference | 20797-48-2(CAS DataBase Reference) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | Hazard Note | Irritant | | HS Code | 29163990 | | Storage Class | 11 - Combustible Solids |
| | 4-Chloro-3-nitrocinnamic acid Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | trans-4-Chloro-3-nitrocinnamic acid may be used in chemical synthesis. | | Synthesis | In a 250mL dry three-necked flask add a certain material quantity ratio of freshly evaporated 4-chloro-3-nitrobenzaldehyde and acetic anhydride, and add a certain amount of catalyst, oscillate to make the mixture homogeneous, install a thermometer and a condenser tube (the upper end of which is connected to a calcium chloride drying tube), and stir it magnetically at a certain temperature for a certain period of time for a full reaction. At the end of the reaction, the pH was adjusted to weakly alkaline with saturated Na2CO3 solution. Then steam distillation until the distillate without oil beads, and then a small amount of activated carbon adsorption of impurities, colorless liquid, while hot, filtration, filtrate with hydrochloric acid adjusted to pH = 3 ~ 4, at this time there are a large number of white crystals precipitated. After standing for a period of time filtration, with a small amount of water to wash the crystals, drying 4-chloro-3-nitro cinnamic acid crude products, crude products with water and ethanol mixture (volume ratio of 3:1) for recrystallization, 4-chloro-3-nitro cinnamic acid yellow crystals. |
| | 4-Chloro-3-nitrocinnamic acid Preparation Products And Raw materials |
|