| Company Name: |
RuiKeXin Gold
|
| Tel: |
19938953786 |
| Email: |
810766265@qq.com |
| Products Intro: |
Product Name:2-[(2S)-4-Bromo-2-methyl-1,3-benzodioxol-2-yl]-5-chloropyridine
CAS:2679763-33-6
Purity:95%;97+% HPLC Package:10mg;10g
|
| Company Name: |
Anhui JYHX CO., LTD.
|
| Tel: |
0551-68788198 13295518198 |
| Email: |
wangyanan@ahjyhx.com |
| Products Intro: |
CAS:2679763-33-6
Purity:95% 97% 98% HPLC Package:MG;G;10G;100G;500G;1kg;100kg;1000kg
|
|
| | Pyridine, 2-[(2S)-4-bromo-2-methyl-1,3-benzodioxol-2-yl]-5-chloro- Basic information |
| | Pyridine, 2-[(2S)-4-bromo-2-methyl-1,3-benzodioxol-2-yl]-5-chloro- Chemical Properties |
| Boiling point | 394.7±42.0 °C(Predicted) | | density | 1.596±0.06 g/cm3(Predicted) | | pka | 0.29±0.29(Predicted) | | InChI | InChI=1S/C13H9BrClNO2/c1-13(11-6-5-8(15)7-16-11)17-10-4-2-3-9(14)12(10)18-13/h2-7H,1H3/t13-/m0/s1 | | InChIKey | APKABHVDPKOXLN-ZDUSSCGKSA-N | | SMILES | C1([C@]2(C)OC3=C(Br)C=CC=C3O2)=NC=C(Cl)C=C1 |
| | Pyridine, 2-[(2S)-4-bromo-2-methyl-1,3-benzodioxol-2-yl]-5-chloro- Usage And Synthesis |
| | Pyridine, 2-[(2S)-4-bromo-2-methyl-1,3-benzodioxol-2-yl]-5-chloro- Preparation Products And Raw materials |
|