- DIPROPETRYN
-
- $1.00 / 1KG
-
2020-01-01
- CAS: 4147-51-7
- Min. Order: 1KG
- Purity: 95-99%
- Supply Ability: 1ton
|
| | DIPROPETRYN Basic information |
| Product Name: | DIPROPETRYN | | Synonyms: | 2-Ethylthio-4,6-bis(isopropylamino)-5-triazine;SANCAP(R);1,3,5-Triazine-2,4-diamine, 6-(ethylthio)-N,N'-bis(1-methylethyl)-;2,4-bis(isopropylamino)-6-ethylthio-s-triazin;2-Ethylthio-4,6-bis(isopropylamino)-s-triazine;6-ethylsulfanyl-2-N,4-N-di(propan-2-yl)-1,3,5-triazine-2,4-diamine;6-ethylsulfanyl-N2,N4-di(propan-2-yl)-1,3,5-triazine-2,4-diamine;Dipropetryn 100mg [4147-51-7] | | CAS: | 4147-51-7 | | MF: | C11H21N5S | | MW: | 255.38 | | EINECS: | 223-973-5 | | Product Categories: | Alphabetic;DIO - DIZPesticides&Metabolites;Alpha sort;D;DAlphabetic;Herbicides;Pesticides&Metabolites;Triazines | | Mol File: | 4147-51-7.mol |  |
| | DIPROPETRYN Chemical Properties |
| Melting point | 105℃ | | Boiling point | 413.0±28.0 °C(Predicted) | | density | 1.1606 (rough estimate) | | refractive index | 1.5500 (estimate) | | pka | 3.78±0.41(Predicted) | | Water Solubility | 16mg/L(room temperature) | | Merck | 13,3376 | | BRN | 614796 | | Henry's Law Constant | 6.0×102 mol/(m3Pa) at 25℃, Hilal et al. (2008) | | Major Application | agriculture environmental | | InChI | 1S/C11H21N5S/c1-6-17-11-15-9(12-7(2)3)14-10(16-11)13-8(4)5/h7-8H,6H2,1-5H3,(H2,12,13,14,15,16) | | InChIKey | NPWMZOGDXOFZIN-UHFFFAOYSA-N | | SMILES | CCSc1nc(NC(C)C)nc(NC(C)C)n1 | | EPA Substance Registry System | Dipropetryn (4147-51-7) |
| Hazard Codes | N | | Risk Statements | 51/53 | | Safety Statements | 60 | | RIDADR | UN3077 9/PG 3 | | WGK Germany | 2 | | RTECS | XY4100000 | | Storage Class | 11 - Combustible Solids | | Toxicity | LC50 (96-hour) for rainbow trout 2.7 mg/L and bluegill sunsh 1.6 mg/L (Hartley and Kidd, 1987); acute oral LD50 for rats 3,900–5,000 mg/kg (Hartley and Kidd, 1987), 7,144 mg/kg (RTECS, 1985). |
| | DIPROPETRYN Usage And Synthesis |
| Chemical Properties | Pure product is white solid. Melting point 104~106℃, relative density 1.12, vapor pressure 9.71×10-5Pa, soluble in acetone, ethanol, dioxane and other organic solvents, solubility 16mg/L in water at 20℃, stable at room temperature and pressure, neutral, slightly acidic, slightly alkaline conditions, but hydrolyzed into hydroxyl derivatives with no herbicidal activity under the condition of strong acid or strong base. | | Uses | Dipropetryn PESTANAL, analytical standard | | Uses | Preemergence herbicide used to control weeds in cotton and melon crops. | | Uses | Herbicide. | | Definition | ChEBI: Dipropetryn is a member of 1,3,5-triazines. | | Environmental Fate | Soil. Degradation of dipropetryn includes dealkylation of the side chain(s), ring opening and the evolution of carbon dioxide (Hartley and Kidd, 1987). The reported half-life in soil is approximately 100 days (Worthing and Hance, 1991). |
| | DIPROPETRYN Preparation Products And Raw materials |
|